EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H32O5 |
| Net Charge | 0 |
| Average Mass | 352.471 |
| Monoisotopic Mass | 352.22497 |
| SMILES | CCCCCC(=O)CC/C=C\C=C\C=C\[C@@H](O)[C@@H](O)CCCC(=O)O |
| InChI | InChI=1S/C20H32O5/c1-2-3-8-12-17(21)13-9-6-4-5-7-10-14-18(22)19(23)15-11-16-20(24)25/h4-7,10,14,18-19,22-23H,2-3,8-9,11-13,15-16H2,1H3,(H,24,25)/b6-4-,7-5+,14-10+/t18-,19+/m1/s1 |
| InChIKey | FPRPRBFSKMFXRV-JWVNNVTNSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | human metabolite Any mammalian metabolite produced during a metabolic reaction in humans (Homo sapiens). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 13,14-dihydro-15-oxolipoxin A4 (CHEBI:63993) has role human metabolite (CHEBI:77746) |
| 13,14-dihydro-15-oxolipoxin A4 (CHEBI:63993) is a hydroxy polyunsaturated fatty acid (CHEBI:140345) |
| 13,14-dihydro-15-oxolipoxin A4 (CHEBI:63993) is a icosanoid (CHEBI:23899) |
| 13,14-dihydro-15-oxolipoxin A4 (CHEBI:63993) is a long-chain fatty acid (CHEBI:15904) |
| 13,14-dihydro-15-oxolipoxin A4 (CHEBI:63993) is a oxo fatty acid (CHEBI:59644) |
| 13,14-dihydro-15-oxolipoxin A4 (CHEBI:63993) is a trienoic fatty acid (CHEBI:73155) |
| 13,14-dihydro-15-oxolipoxin A4 (CHEBI:63993) is conjugate acid of 13,14-dihydro-15-oxolipoxin A4(1−) (CHEBI:78325) |
| Incoming Relation(s) |
| 13,14-dihydro-15-oxolipoxin A4(1−) (CHEBI:78325) is conjugate base of 13,14-dihydro-15-oxolipoxin A4 (CHEBI:63993) |
| IUPAC Name |
|---|
| (5S,6R,7E,9E,11Z)-5,6-dihydroxy-15-oxoicosa-7,9,11-trienoic acid |
| Synonyms | Source |
|---|---|
| dhk-LXA4 | SUBMITTER |
| 13,14-dihydro-15-keto-LXA4 | LIPID MAPS |
| 13,14-dihydro-15-keto-Lipoxin A4 | LIPID MAPS |
| 15-oxo-5S,6R-dihydroxy-7E,9E,11Z-eicosatrienoic acid | LIPID MAPS |
| Manual Xrefs | Databases |
|---|---|
| LMFA03040008 | LIPID MAPS |