EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H30O5 |
| Net Charge | 0 |
| Average Mass | 350.455 |
| Monoisotopic Mass | 350.20932 |
| SMILES | CCCCCC(=O)/C=C/C=C\C=C\C=C\[C@@H](O)[C@@H](O)CCCC(=O)O |
| InChI | InChI=1S/C20H30O5/c1-2-3-8-12-17(21)13-9-6-4-5-7-10-14-18(22)19(23)15-11-16-20(24)25/h4-7,9-10,13-14,18-19,22-23H,2-3,8,11-12,15-16H2,1H3,(H,24,25)/b6-4-,7-5+,13-9+,14-10+/t18-,19+/m1/s1 |
| InChIKey | KMQGFEBCBYXSPZ-OABWHSJTSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | specialised pro-resolving mediator A class of cell signaling molecules enzymatically derived from n-3 long chain polyunsaturated fatty acids that have important roles in orchestrating the resolution of tissue inflammation. |
| Application: | specialised pro-resolving mediator A class of cell signaling molecules enzymatically derived from n-3 long chain polyunsaturated fatty acids that have important roles in orchestrating the resolution of tissue inflammation. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 15-oxolipoxin A4 (CHEBI:63992) is a hydroxy polyunsaturated fatty acid (CHEBI:140345) |
| 15-oxolipoxin A4 (CHEBI:63992) is a lipoxin (CHEBI:6497) |
| 15-oxolipoxin A4 (CHEBI:63992) is a long-chain fatty acid (CHEBI:15904) |
| 15-oxolipoxin A4 (CHEBI:63992) is a oxo fatty acid (CHEBI:59644) |
| 15-oxolipoxin A4 (CHEBI:63992) is conjugate acid of 15-oxolipoxin A4(1−) (CHEBI:78311) |
| Incoming Relation(s) |
| 15-oxolipoxin A4(1−) (CHEBI:78311) is conjugate base of 15-oxolipoxin A4 (CHEBI:63992) |
| IUPAC Name |
|---|
| (5S,6R,7E,9E,11Z,13E)-5,6-dihydroxy-15-oxoicosa-7,9,11,13-tetraenoic acid |
| Synonyms | Source |
|---|---|
| 15-oxo-LXA4 | LIPID MAPS |
| 15-keto-Lipoxin A4 | LIPID MAPS |
| 15-keto-LXA4 | LIPID MAPS |
| 15-oxo-5S,6R-dihydroxy-7E,9E,11Z,13E-eicosatetraenoic acid | LIPID MAPS |
| Manual Xrefs | Databases |
|---|---|
| LMFA03040009 | LIPID MAPS |