EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C23H37NO5S |
| Net Charge | 0 |
| Average Mass | 439.618 |
| Monoisotopic Mass | 439.23924 |
| SMILES | CCCCC[C@H](O)[C@@H](/C=C/C=C/C=C\C/C=C\CCCC(=O)O)SC[C@H](N)C(=O)O |
| InChI | InChI=1S/C23H37NO5S/c1-2-3-12-15-20(25)21(30-18-19(24)23(28)29)16-13-10-8-6-4-5-7-9-11-14-17-22(26)27/h4,6-10,13,16,19-21,25H,2-3,5,11-12,14-15,17-18,24H2,1H3,(H,26,27)(H,28,29)/b6-4-,9-7-,10-8+,16-13+/t19-,20-,21+/m0/s1 |
| InChIKey | JLJNENVYAVKECZ-HRXVJLLUSA-N |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| eoxin E4 (CHEBI:63986) has functional parent (5Z,8Z,10E,12E)-icosatetraenoic acid (CHEBI:64014) |
| eoxin E4 (CHEBI:63986) has role metabolite (CHEBI:25212) |
| eoxin E4 (CHEBI:63986) is a eoxin (CHEBI:193574) |
| eoxin E4 (CHEBI:63986) is a leukotriene (CHEBI:25029) |
| Incoming Relation(s) |
| eoxin E4(1-) (CHEBI:747194) is conjugate base of eoxin E4 (CHEBI:63986) |
| IUPAC Names |
|---|
| (5Z,8Z,10E,12E,14R,15S)-14-{[(2R)-2-amino-2-carboxyethyl]sulfanyl}-15-hydroxyicosa-5,8,10,12-tetraenoic acid |
| S-[(6S,7R,8E,10E,12Z,15Z)-19-carboxy-6-hydroxynonadeca-8,10,12,15-tetraen-7-yl]-L-cysteine |
| Synonyms | Source |
|---|---|
| 14,15-Leukotriene E4 | SUBMITTER |
| 14,15-LTE4 | SUBMITTER |
| 15S-hydroxy,14R-(S-cysteinyl)-5Z,8Z,10E,12E-eicosatetraenoic acid | LIPID MAPS |
| EXE4 | SUBMITTER |
| Manual Xrefs | Databases |
|---|---|
| LMFA03020033 | LIPID MAPS |
| US2009247634 | Patent |
| WO2008001079 | Patent |
| Registry Numbers | Sources |
|---|---|
| Reaxys:19521974 | Reaxys |