EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C18H26O6 |
| Net Charge | 0 |
| Average Mass | 338.400 |
| Monoisotopic Mass | 338.17294 |
| SMILES | O=C(O)CC/C=C\C[C@@H](O)/C=C/C=C/C=C\[C@@H](O)CCCC(=O)O |
| InChI | InChI=1S/C18H26O6/c19-15(11-6-3-7-13-17(21)22)9-4-1-2-5-10-16(20)12-8-14-18(23)24/h1-6,9-10,15-16,19-20H,7-8,11-14H2,(H,21,22)(H,23,24)/b2-1+,6-3-,9-4+,10-5-/t15-,16+/m0/s1 |
| InChIKey | XWRIIHRGMKHPHN-USRRKILKSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 18-hydroxy-18-oxo-dinorleukotriene B4 (CHEBI:63980) has functional parent leukotriene B4 (CHEBI:15647) |
| 18-hydroxy-18-oxo-dinorleukotriene B4 (CHEBI:63980) has role metabolite (CHEBI:25212) |
| 18-hydroxy-18-oxo-dinorleukotriene B4 (CHEBI:63980) is a octadecatetraenedioic acid (CHEBI:64013) |
| IUPAC Name |
|---|
| (4Z,7R,8E,10E,12Z,14S)-7,14-dihydroxyoctadeca-4,8,10,12-tetraenedioic acid |
| Synonyms | Source |
|---|---|
| 18-Carboxy-19,20-dinorleukotriene B4 | ChemIDplus |
| 18-carboxy-dinorleukotriene B4 | ChEBI |
| 18-carboxy dinor LTB4 | SUBMITTER |
| 18-Cooh-19,20-ltb4 | ChemIDplus |
| 18-COOH dinor LTB4 | SUBMITTER |
| 18-hydroxy-18-oxo-19,20-dinorleukotriene B4 | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:8356778 | Reaxys |
| CAS:102674-12-4 | ChemIDplus |
| Citations |
|---|