EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H6ClNO3 |
| Net Charge | 0 |
| Average Mass | 223.615 |
| Monoisotopic Mass | 223.00362 |
| SMILES | O=C(O)c1cc(O)c2ccc(Cl)cc2n1 |
| InChI | InChI=1S/C10H6ClNO3/c11-5-1-2-6-7(3-5)12-8(10(14)15)4-9(6)13/h1-4H,(H,12,13)(H,14,15) |
| InChIKey | UAWVRVFHMOSAPU-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | NMDA receptor antagonist Any substance that inhibits the action of N-methyl-D-aspartate (NMDA) receptors. They tend to induce a state known as dissociative anesthesia, marked by catalepsy, amnesia, and analgesia, while side effects can include hallucinations, nightmares, and confusion. Due to their psychotomimetic effects, many NMDA receptor antagonists are used as recreational drugs. |
| Application: | neuroprotective agent Any compound that can be used for the treatment of neurodegenerative disorders. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 7-chlorokynurenic acid (CHEBI:63965) has role neuroprotective agent (CHEBI:63726) |
| 7-chlorokynurenic acid (CHEBI:63965) has role NMDA receptor antagonist (CHEBI:60643) |
| 7-chlorokynurenic acid (CHEBI:63965) is a organochlorine compound (CHEBI:36683) |
| 7-chlorokynurenic acid (CHEBI:63965) is a quinolinemonocarboxylic acid (CHEBI:26512) |
| IUPAC Name |
|---|
| 7-chloro-4-hydroxyquinoline-2-carboxylic acid |
| Synonyms | Source |
|---|---|
| 7-Cl-KYNA | ChEBI |
| 7-CKA | ChEBI |
| 7-chloro-4-hydroxy-2-carboxyquinoline | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| LSM-24944 | LINCS |
| Registry Numbers | Sources |
|---|---|
| Reaxys:185645 | Reaxys |
| CAS:18000-24-3 | ChemIDplus |
| Citations |
|---|