EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C8H17N3O2.2HCl |
| Net Charge | 0 |
| Average Mass | 260.165 |
| Monoisotopic Mass | 259.08543 |
| SMILES | CC(=N)NCCCC[C@H](N)C(=O)O.Cl.Cl |
| InChI | InChI=1S/C8H17N3O2.2ClH/c1-6(9)11-5-3-2-4-7(10)8(12)13;;/h7H,2-5,10H2,1H3,(H2,9,11)(H,12,13);2*1H/t7-;;/m0../s1 |
| InChIKey | OQIBCXRAFAHXMM-KLXURFKVSA-N |
| Roles Classification |
|---|
| Biological Role: | EC 1.14.13.39 (nitric oxide synthase) inhibitor An EC 1.14.13.* (oxidoreductase acting on paired donors, incorporating 1 atom of oxygen, with NADH or NADPH as one donor) inhibitor that interferes with the action of nitric oxide synthase (EC 1.14.13.39). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| N6-acetimidoyl-L-lysine dihydrochloride (CHEBI:63964) has part N6-acetimidoyl-L-lysinium(2+) (CHEBI:63968) |
| N6-acetimidoyl-L-lysine dihydrochloride (CHEBI:63964) has role EC 1.14.13.39 (nitric oxide synthase) inhibitor (CHEBI:61908) |
| N6-acetimidoyl-L-lysine dihydrochloride (CHEBI:63964) is a hydrochloride (CHEBI:36807) |
| IUPAC Name |
|---|
| N6-ethanimidoyl-L-lysine dihydrochloride |
| Synonyms | Source |
|---|---|
| N6-acetimidoyl-L-lysine hydrochloride | ChEBI |
| N6-acetimidoyllysine dihydrochloride | ChEBI |
| (1-{[(5S)-5-ammonio-5-carboxypentyl]amino}ethylidene)ammonium dichloride | IUPAC |
| L-N6-(1-iminoethyl)lysine dihydrochloride | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:7083584 | Reaxys |