EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C29H38O4 |
| Net Charge | 0 |
| Average Mass | 450.619 |
| Monoisotopic Mass | 450.27701 |
| SMILES | [H][C@@]12C[C@](C)(C(=O)O)CC[C@]1(C)CC[C@]1(C)C3=CC=C4C(=CC(=O)C(O)=C4C)[C@]3(C)CC[C@@]21C |
| InChI | InChI=1S/C29H38O4/c1-17-18-7-8-21-27(4,19(18)15-20(30)23(17)31)12-14-29(6)22-16-26(3,24(32)33)10-9-25(22,2)11-13-28(21,29)5/h7-8,15,22,31H,9-14,16H2,1-6H3,(H,32,33)/t22-,25-,26-,27+,28-,29+/m1/s1 |
| InChIKey | KQJSQWZMSAGSHN-JJWQIEBTSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Celastrus hypoleucus (ncbitaxon:489980) | root (BTO:0001188) | PubMed (15593077) | |
| Celastrus orbiculatus (ncbitaxon:85181) | root (BTO:0001188) | PubMed (11809076) | |
| Celastrus paniculatus (ncbitaxon:994668) | root (BTO:0001188) | DOI (10.1016/0031-9422(90)80182-G) | Previous component: root outer bark; |
| Tripterygium wilfordii (ncbitaxon:458696) | |||
| root (BTO:0001188) | DOI (10.1186/1471-2202-6-1) | Previous component: root bark; | |
| root (BTO:0001188) | PubMed (21486005) | Root extract |
| Roles Classification |
|---|
| Chemical Roles: | antioxidant A substance that opposes oxidation or inhibits reactions brought about by dioxygen or peroxides. Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | Hsp90 inhibitor An EC 3.6.4.10 (non-chaperonin molecular chaperone ATPase) inhibitor that blocks the action of heat shock protein 90. EC 5.99.1.3 [DNA topoisomerase (ATP-hydrolysing)] inhibitor A topoisomerase inhibitor that inhibits DNA topoisomerase (ATP-hydrolysing), EC 5.99.1.3 (also known as topoisomerase II and as DNA gyrase), which catalyses ATP-dependent breakage of both strands of DNA, passage of the unbroken strands through the breaks, and rejoining of the broken strands. metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| Applications: | anti-inflammatory drug A substance that reduces or suppresses inflammation. antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| celastrol (CHEBI:63959) has role anti-inflammatory drug (CHEBI:35472) |
| celastrol (CHEBI:63959) has role antineoplastic agent (CHEBI:35610) |
| celastrol (CHEBI:63959) has role antioxidant (CHEBI:22586) |
| celastrol (CHEBI:63959) has role EC 5.99.1.3 [DNA topoisomerase (ATP-hydrolysing)] inhibitor (CHEBI:50750) |
| celastrol (CHEBI:63959) has role Hsp90 inhibitor (CHEBI:63962) |
| celastrol (CHEBI:63959) has role metabolite (CHEBI:25212) |
| celastrol (CHEBI:63959) is a monocarboxylic acid (CHEBI:25384) |
| celastrol (CHEBI:63959) is a pentacyclic triterpenoid (CHEBI:25872) |
| IUPAC Name |
|---|
| (2R,4aS,6aS,12bR,14aS,14bR)-10-hydroxy-2,4a,6a,9,12b,14a-hexamethyl-11-oxo-1,2,3,4,4a,5,6,6a,11,12b,13,14,14a,14b-tetradecahydropicene-2-carboxylic acid |
| Synonyms | Source |
|---|---|
| (2R,4aS,6aS,12bR,14aS,14bR)-1,2,3,4,4a,5,6,6a,11,12b,13,14,14a,14b-tetradecahydro-10-hydroxy-2,4a,6a,9,12b,14a-hexamethyl-11-oxo-2-picenecarboxylic acid | ChEBI |
| 3-hydroxy-9β,13α-dimethyl-2-oxo-24,25,26-trinoroleana-1(10),3,5,7-tetraen-29-oic acid | ChEBI |
| D:A-Friedo-24-noroleana-1(10),3,5,7-tetraen-29-oic acid, 3-hydroxy-2-oxo-, (20alpha)- | ChemIDplus |
| Tripterine | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| HMDB0002385 | HMDB |
| KR20100097843 | Patent |
| US2011263693 | Patent |
| Registry Numbers | Sources |
|---|---|
| Reaxys:2194425 | Reaxys |
| CAS:34157-83-0 | ChemIDplus |
| Citations |
|---|