EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C29H38O4 |
| Net Charge | 0 |
| Average Mass | 450.619 |
| Monoisotopic Mass | 450.27701 |
| SMILES | [H][C@@]12C[C@](C)(C(=O)O)CC[C@]1(C)CC[C@]1(C)C3=CC=C4C(=CC(=O)C(O)=C4C)[C@]3(C)CC[C@@]21C |
| InChI | InChI=1S/C29H38O4/c1-17-18-7-8-21-27(4,19(18)15-20(30)23(17)31)12-14-29(6)22-16-26(3,24(32)33)10-9-25(22,2)11-13-28(21,29)5/h7-8,15,22,31H,9-14,16H2,1-6H3,(H,32,33)/t22-,25-,26-,27+,28-,29+/m1/s1 |
| InChIKey | KQJSQWZMSAGSHN-JJWQIEBTSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Tripterygium wilfordii (ncbitaxon:458696) | |||
| root (BTO:0001188) | DOI (10.1186/1471-2202-6-1) | Previous component: root bark; | |
| root (BTO:0001188) | PubMed (21486005) | Root extract | |
| Celastrus paniculatus (ncbitaxon:994668) | root (BTO:0001188) | DOI (10.1016/0031-9422(90)80182-G) | Previous component: root outer bark; |
| Celastrus hypoleucus (ncbitaxon:489980) | root (BTO:0001188) | PubMed (15593077) | |
| Celastrus orbiculatus (ncbitaxon:85181) | root (BTO:0001188) | PubMed (11809076) |
| Roles Classification |
|---|
| Chemical Roles: | antioxidant A substance that opposes oxidation or inhibits reactions brought about by dioxygen or peroxides. Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. Hsp90 inhibitor An EC 3.6.4.10 (non-chaperonin molecular chaperone ATPase) inhibitor that blocks the action of heat shock protein 90. EC 5.99.1.3 [DNA topoisomerase (ATP-hydrolysing)] inhibitor A topoisomerase inhibitor that inhibits DNA topoisomerase (ATP-hydrolysing), EC 5.99.1.3 (also known as topoisomerase II and as DNA gyrase), which catalyses ATP-dependent breakage of both strands of DNA, passage of the unbroken strands through the breaks, and rejoining of the broken strands. |
| Applications: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. anti-inflammatory drug A substance that reduces or suppresses inflammation. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| celastrol (CHEBI:63959) has role anti-inflammatory drug (CHEBI:35472) |
| celastrol (CHEBI:63959) has role antineoplastic agent (CHEBI:35610) |
| celastrol (CHEBI:63959) has role antioxidant (CHEBI:22586) |
| celastrol (CHEBI:63959) has role EC 5.99.1.3 [DNA topoisomerase (ATP-hydrolysing)] inhibitor (CHEBI:50750) |
| celastrol (CHEBI:63959) has role Hsp90 inhibitor (CHEBI:63962) |
| celastrol (CHEBI:63959) has role metabolite (CHEBI:25212) |
| celastrol (CHEBI:63959) is a monocarboxylic acid (CHEBI:25384) |
| celastrol (CHEBI:63959) is a pentacyclic triterpenoid (CHEBI:25872) |
| IUPAC Name |
|---|
| (2R,4aS,6aS,12bR,14aS,14bR)-10-hydroxy-2,4a,6a,9,12b,14a-hexamethyl-11-oxo-1,2,3,4,4a,5,6,6a,11,12b,13,14,14a,14b-tetradecahydropicene-2-carboxylic acid |
| Synonyms | Source |
|---|---|
| Tripterine | ChemIDplus |
| 3-hydroxy-9β,13α-dimethyl-2-oxo-24,25,26-trinoroleana-1(10),3,5,7-tetraen-29-oic acid | ChEBI |
| D:A-Friedo-24-noroleana-1(10),3,5,7-tetraen-29-oic acid, 3-hydroxy-2-oxo-, (20alpha)- | ChemIDplus |
| (2R,4aS,6aS,12bR,14aS,14bR)-1,2,3,4,4a,5,6,6a,11,12b,13,14,14a,14b-tetradecahydro-10-hydroxy-2,4a,6a,9,12b,14a-hexamethyl-11-oxo-2-picenecarboxylic acid | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| US2011263693 | Patent |
| KR20100097843 | Patent |
| HMDB0002385 | HMDB |
| Registry Numbers | Sources |
|---|---|
| Reaxys:2194425 | Reaxys |
| CAS:34157-83-0 | ChemIDplus |
| Citations |
|---|