EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C18H24N2O4 |
| Net Charge | 0 |
| Average Mass | 332.400 |
| Monoisotopic Mass | 332.17361 |
| SMILES | CCC(C)(CC)c1cc(NC(=O)c2c(OC)cccc2OC)on1 |
| InChI | InChI=1S/C18H24N2O4/c1-6-18(3,7-2)14-11-15(24-20-14)19-17(21)16-12(22-4)9-8-10-13(16)23-5/h8-11H,6-7H2,1-5H3,(H,19,21) |
| InChIKey | PMHURSZHKKJGBM-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | cellulose synthesis inhibitor An pathway inhibitor that inhibits the synthesis of cellulose. |
| Application: | herbicide A substance used to destroy plant pests. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| isoxaben (CHEBI:63956) has role cellulose synthesis inhibitor (CHEBI:63958) |
| isoxaben (CHEBI:63956) has role herbicide (CHEBI:24527) |
| isoxaben (CHEBI:63956) is a benzamides (CHEBI:22702) |
| isoxaben (CHEBI:63956) is a isoxazoles (CHEBI:55373) |
| IUPAC Name |
|---|
| 2,6-dimethoxy-N-[3-(3-methylpentan-3-yl)-1,2-oxazol-5-yl]benzamide |
| Synonyms | Source |
|---|---|
| 2,6-Dimethoxy-N-(3-(1-ethyl-1-methylpropyl)-5-isoxazolyl)benzamide | ChemIDplus |
| N-(3-(1-Ethyl-1-methylpropyl)-5-isoxazolyl)-2,6-dimethoxybenzamide | ChemIDplus |
| Registry Numbers | Sources |
|---|---|
| Reaxys:6612136 | Reaxys |
| CAS:82558-50-7 | KEGG COMPOUND |
| CAS:82558-50-7 | ChemIDplus |
| CAS:82558-50-7 | NIST Chemistry WebBook |
| Citations |
|---|