EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C41H72O9 |
| Net Charge | 0 |
| Average Mass | 709.018 |
| Monoisotopic Mass | 708.51763 |
| SMILES | [H][C@@]1(C[C@H](O)[C@H](C)[C@H](O)[C@H](C)/C=C/C[C@@H](C)C[C@@H](C)/C(O)=C/C(=O)[C@@H](C)C[C@@H](C)C[C@H](C)CCC(=O)O)CC[C@@](C)([C@@]2([H])CC[C@@](C)([C@@H](C)O)O2)O1 |
| InChI | InChI=1S/C41H72O9/c1-25(21-29(5)34(43)24-35(44)30(6)22-27(3)20-26(2)14-15-38(46)47)12-11-13-28(4)39(48)31(7)36(45)23-33-16-18-41(10,49-33)37-17-19-40(9,50-37)32(8)42/h11,13,24-33,36-37,39,42-43,45,48H,12,14-23H2,1-10H3,(H,46,47)/b13-11+,34-24-/t25-,26-,27+,28-,29-,30+,31+,32-,33+,36+,37-,39-,40+,41+/m1/s1 |
| InChIKey | PGHMRUGBZOYCAA-ADZNBVRBSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| ionomycin (CHEBI:63954) has role calcium ionophore (CHEBI:22986) |
| ionomycin (CHEBI:63954) has role metabolite (CHEBI:25212) |
| ionomycin (CHEBI:63954) is a cyclic ether (CHEBI:37407) |
| ionomycin (CHEBI:63954) is a enol (CHEBI:33823) |
| ionomycin (CHEBI:63954) is a polyunsaturated fatty acid (CHEBI:26208) |
| ionomycin (CHEBI:63954) is a very long-chain fatty acid (CHEBI:27283) |
| IUPAC Name |
|---|
| (4R,6S,8S,10Z,12R,14R,16E,18R,19R,20S,21S)-11,19,21-trihydroxy-22-{(2S,2'R,5S,5'S)-5'-[(1R)-1-hydroxyethyl]-2,5'-dimethyloctahydro-2,2'-bifuran-5-yl}-4,6,8,12,14,18,20-heptamethyl-9-oxodocosa-10,16-dienoic acid |
| Manual Xrefs | Databases |
|---|---|
| US3873693 | Patent |
| Registry Numbers | Sources |
|---|---|
| Reaxys:3642126 | Reaxys |
| CAS:56092-81-0 | ChemIDplus |
| Citations |
|---|