EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C9H8ClN5O3S |
| Net Charge | 0 |
| Average Mass | 301.715 |
| Monoisotopic Mass | 301.00364 |
| SMILES | Nc1nc(Cl)nc(Nc2cccc(S(=O)(=O)O)c2)n1 |
| InChI | InChI=1S/C9H8ClN5O3S/c10-7-13-8(11)15-9(14-7)12-5-2-1-3-6(4-5)19(16,17)18/h1-4H,(H,16,17,18)(H3,11,12,13,14,15) |
| InChIKey | INKDIXXCRXOUGO-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2-amino-6-chloro-4-(3-sulfoanilino)-1,3,5-triazine (CHEBI:63953) is a arenesulfonic acid (CHEBI:33555) |
| 2-amino-6-chloro-4-(3-sulfoanilino)-1,3,5-triazine (CHEBI:63953) is a diamino-1,3,5-triazine (CHEBI:38170) |
| 2-amino-6-chloro-4-(3-sulfoanilino)-1,3,5-triazine (CHEBI:63953) is conjugate acid of 2-amino-6-chloro-4-(3-sulfonatoanilino)-1,3,5-triazine (CHEBI:63955) |
| Incoming Relation(s) |
| 2-amino-6-chloro-4-(3-sulfonatoanilino)-1,3,5-triazine (CHEBI:63955) is conjugate base of 2-amino-6-chloro-4-(3-sulfoanilino)-1,3,5-triazine (CHEBI:63953) |
| IUPAC Name |
|---|
| 3-[(4-amino-6-chloro-1,3,5-triazin-2-yl)amino]benzenesulfonic acid |
| Synonym | Source |
|---|---|
| 2-amino-6-chloro-4-(3-sulfoanilino)-1,3,5-triazine | ChEBI |
| Citations |
|---|