EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C3H10Sn |
| Net Charge | 0 |
| Average Mass | 164.824 |
| Monoisotopic Mass | 165.98045 |
| SMILES | [H][Sn]([CH3])([CH3])[CH3] |
| InChI | InChI=1S/3CH3.Sn.H/h3*1H3;; |
| InChIKey | UKHQRARQNZOXRL-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | neurotoxin A poison that interferes with the functions of the nervous system. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| trimethyltin (CHEBI:63948) has parent hydride stannane (CHEBI:30419) |
| trimethyltin (CHEBI:63948) has role neurotoxin (CHEBI:50910) |
| trimethyltin (CHEBI:63948) is a organotin compound (CHEBI:25717) |
| IUPAC Name |
|---|
| trimethylstannane |
| Synonyms | Source |
|---|---|
| HSnMe3 | ChEBI |
| Me3SnH | ChEBI |
| trimethyltin hydride | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:4123006 | Reaxys |
| CAS:1631-73-8 | ChemIDplus |
| CAS:1631-73-8 | NIST Chemistry WebBook |
| CAS:17272-57-0 | ChemIDplus |
| CAS:17272-57-0 | NIST Chemistry WebBook |
| Citations |
|---|