EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C26H20N2O6S2 |
| Net Charge | 0 |
| Average Mass | 520.588 |
| Monoisotopic Mass | 520.07628 |
| SMILES | Cc1cc(-c2ccc(S(=O)(=O)O)cc2)c2ccc3c(-c4ccc(S(=O)(=O)O)cc4)cc(C)nc3c2n1 |
| InChI | InChI=1S/C26H20N2O6S2/c1-15-13-23(17-3-7-19(8-4-17)35(29,30)31)21-11-12-22-24(14-16(2)28-26(22)25(21)27-15)18-5-9-20(10-6-18)36(32,33)34/h3-14H,1-2H3,(H,29,30,31)(H,32,33,34) |
| InChIKey | FBKZHCDISZZXDK-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | chelator A ligand with two or more separate binding sites that can bind to a single metallic central atom, forming a chelate. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| bathocuproine disulfonic acid (CHEBI:63934) has parent hydride 1,10-phenanthroline (CHEBI:44975) |
| bathocuproine disulfonic acid (CHEBI:63934) has role chelator (CHEBI:38161) |
| bathocuproine disulfonic acid (CHEBI:63934) is a arenesulfonic acid (CHEBI:33555) |
| bathocuproine disulfonic acid (CHEBI:63934) is a phenanthrolines (CHEBI:48835) |
| IUPAC Name |
|---|
| 4,4'-(2,9-dimethyl-1,10-phenanthroline-4,7-diyl)dibenzenesulfonic acid |
| Synonyms | Source |
|---|---|
| Bathocuproine disulfonate | ChemIDplus |
| Bathocuproine sulfonate | ChemIDplus |
| Bathocuproinedisulphonic acid | ChemIDplus |
| Registry Numbers | Sources |
|---|---|
| Reaxys:9595708 | Reaxys |
| CAS:73348-75-1 | ChemIDplus |
| Citations |
|---|