EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C18H23NO6 |
| Net Charge | 0 |
| Average Mass | 349.383 |
| Monoisotopic Mass | 349.15254 |
| SMILES | [H][C@]12C3=CCN1CC[C@H]2OC(=O)/C(=C\C)CC(=C)[C@](O)(CO)C(=O)OC3 |
| InChI | InChI=1S/C18H23NO6/c1-3-12-8-11(2)18(23,10-20)17(22)24-9-13-4-6-19-7-5-14(15(13)19)25-16(12)21/h3-4,14-15,20,23H,2,5-10H2,1H3/b12-3-/t14-,15-,18-/m1/s1 |
| InChIKey | SVCNNZDUGWLODJ-RAYFHMIRSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Roles: | genotoxin A role played by a chemical compound to induce direct or indirect DNA damage. Such damage can potentially lead to the formation of a malignant tumour, but DNA damage does not lead inevitably to the creation of cancerous cells. mutagen An agent that increases the frequency of mutations above the normal background level, usually by interacting directly with DNA and causing it damage, including base substitution. carcinogenic agent A role played by a chemical compound which is known to induce a process of carcinogenesis by corrupting normal cellular pathways, leading to the acquistion of tumoral capabilities. metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| riddelliine (CHEBI:63924) has functional parent senecionan (CHEBI:36330) |
| riddelliine (CHEBI:63924) has role carcinogenic agent (CHEBI:50903) |
| riddelliine (CHEBI:63924) has role genotoxin (CHEBI:50902) |
| riddelliine (CHEBI:63924) has role mutagen (CHEBI:25435) |
| riddelliine (CHEBI:63924) is a macrodiolide (CHEBI:145556) |
| riddelliine (CHEBI:63924) is a olefinic compound (CHEBI:78840) |
| riddelliine (CHEBI:63924) is a organic heterotricyclic compound (CHEBI:26979) |
| riddelliine (CHEBI:63924) is a pyrrolizine alkaloid (CHEBI:38521) |
| Incoming Relation(s) |
| riddelliine N-oxide (CHEBI:136421) has functional parent riddelliine (CHEBI:63924) |
| IUPAC Name |
|---|
| (15Z)-12,18-dihydroxy-13,19-didehydrosenecionan-11,16-dione |
| Synonyms | Source |
|---|---|
| Riddeliin | ChemIDplus |
| Riddelline | ChemIDplus |
| Riddeliine | ChemIDplus |
| 18-Hydroxyseneciphylline | KEGG COMPOUND |
| Manual Xrefs | Databases |
|---|---|
| Riddelliine | Wikipedia |
| C00002110 | KNApSAcK |
| C10375 | KEGG COMPOUND |
| Registry Numbers | Sources |
|---|---|
| Reaxys:1042830 | Reaxys |
| CAS:23246-96-0 | ChemIDplus |
| CAS:23246-96-0 | NIST Chemistry WebBook |
| CAS:23246-96-0 | KEGG COMPOUND |
| Citations |
|---|