EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C22H32O4 |
| Net Charge | 0 |
| Average Mass | 360.494 |
| Monoisotopic Mass | 360.23006 |
| SMILES | [H][C@]1(/C=C/[C@@H](O)C(C)CC#CC)[C@H](O)C[C@@H]2C/C(=C\CCCC(=O)O)C[C@@H]21 |
| InChI | InChI=1S/C22H32O4/c1-3-4-7-15(2)20(23)11-10-18-19-13-16(8-5-6-9-22(25)26)12-17(19)14-21(18)24/h8,10-11,15,17-21,23-24H,5-7,9,12-14H2,1-2H3,(H,25,26)/b11-10+,16-8+/t15?,17-,18+,19-,20+,21+/m0/s1 |
| InChIKey | HIFJCPQKFCZDDL-ACWOEMLNSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Applications: | platelet aggregation inhibitor A drug or agent which antagonizes or impairs any mechanism leading to blood platelet aggregation, whether during the phases of activation and shape change or following the dense-granule release reaction and stimulation of the prostaglandin-thromboxane system. vasodilator agent A drug used to cause dilation of the blood vessels. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| iloprost (CHEBI:63916) has role platelet aggregation inhibitor (CHEBI:50427) |
| iloprost (CHEBI:63916) has role vasodilator agent (CHEBI:35620) |
| iloprost (CHEBI:63916) is a carbobicyclic compound (CHEBI:36785) |
| iloprost (CHEBI:63916) is a monocarboxylic acid (CHEBI:25384) |
| iloprost (CHEBI:63916) is a secondary alcohol (CHEBI:35681) |
| IUPAC Name |
|---|
| (5E)-5-[(3aS,4R,5R,6aS)-5-hydroxy-4-[(1E,3S)-3-hydroxy-4-methyloct-1-en-6-yn-1-yl]hexahydropentalen-2(1H)-ylidene]pentanoic acid |
| INNs | Source |
|---|---|
| iloprostum | ChemIDplus |
| iloprost | ChemIDplus |
| Synonym | Source |
|---|---|
| (16R,S)-methyl-18,18,19,19-tetradehydro-6a-carbaprostaglandin I2 | ChemIDplus |
| Citations |
|---|