EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C6H14O |
| Net Charge | 0 |
| Average Mass | 102.177 |
| Monoisotopic Mass | 102.10447 |
| SMILES | CC(C)CCCO |
| InChI | InChI=1S/C6H14O/c1-6(2)4-3-5-7/h6-7H,3-5H2,1-2H3 |
| InChIKey | PCWGTDULNUVNBN-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 4-methylpentan-1-ol (CHEBI:63910) has role metabolite (CHEBI:25212) |
| 4-methylpentan-1-ol (CHEBI:63910) is a alkyl alcohol (CHEBI:50584) |
| 4-methylpentan-1-ol (CHEBI:63910) is a primary alcohol (CHEBI:15734) |
| Incoming Relation(s) |
| 4-methylpentyl hexadecanoate (CHEBI:235327) has functional parent 4-methylpentan-1-ol (CHEBI:63910) |
| IUPAC Name |
|---|
| 4-methylpentan-1-ol |
| Synonyms | Source |
|---|---|
| 4-Methylpentanol | ChemIDplus |
| Isohexyl alcohol | ChemIDplus |
| 4-Methyl-1-pentanol | ChemIDplus |
| Isohexanol | ChemIDplus |
| iso-Hexanol | ChemIDplus |
| 2-Methyl-5-pentanol | NIST Chemistry WebBook |
| UniProt Name | Source |
|---|---|
| 4-methylpentan-1-ol | UniProt |
| Manual Xrefs | Databases |
|---|---|
| HMDB0059889 | HMDB |
| 4-Methylpentan-1-ol | Wikipedia |
| US2011177571 | Patent |
| Citations |
|---|