EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C27H44O |
| Net Charge | 0 |
| Average Mass | 384.648 |
| Monoisotopic Mass | 384.33922 |
| SMILES | [H][C@@]12CC=C3CC(=O)CC[C@]3(C)[C@@]1([H])CC[C@@]1(C)[C@@]2([H])CC[C@]1([H])[C@H](C)CCCC(C)C |
| InChI | InChI=1S/C27H44O/c1-18(2)7-6-8-19(3)23-11-12-24-22-10-9-20-17-21(28)13-15-26(20,4)25(22)14-16-27(23,24)5/h9,18-19,22-25H,6-8,10-17H2,1-5H3/t19-,22+,23-,24+,25+,26+,27-/m1/s1 |
| InChIKey | GGCLNOIGPMGLDB-GYKMGIIDSA-N |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| cholest-5-en-3-one (CHEBI:63906) has role metabolite (CHEBI:25212) |
| cholest-5-en-3-one (CHEBI:63906) is a 3-oxo-Δ5-steroid (CHEBI:47907) |
| cholest-5-en-3-one (CHEBI:63906) is a cholestanoid (CHEBI:50401) |
| IUPAC Name |
|---|
| cholest-5-en-3-one |
| Synonyms | Source |
|---|---|
| Δ5-cholestenone | ChemIDplus |
| 5-cholesten-3-one | ChemIDplus |
| cholesterone | ChemIDplus |
| cholestenone | ChemIDplus |
| oxidized cholesterol | ChemIDplus |
| UniProt Name | Source |
|---|---|
| cholest-5-en-3-one | UniProt |
| Registry Numbers | Sources |
|---|---|
| Reaxys:2224118 | Reaxys |
| CAS:601-54-7 | ChemIDplus |
| Citations |
|---|