EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C9H7N |
| Net Charge | 0 |
| Average Mass | 129.162 |
| Monoisotopic Mass | 129.05785 |
| SMILES | C=C1C=Nc2ccccc21 |
| InChI | InChI=1S/C9H7N/c1-7-6-10-9-5-3-2-4-8(7)9/h2-6H,1H2 |
| InChIKey | BCNUXXXHEIUHJB-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 3-methyleneindolenine (CHEBI:63905) has role metabolite (CHEBI:25212) |
| 3-methyleneindolenine (CHEBI:63905) is a indoles (CHEBI:24828) |
| IUPAC Name |
|---|
| 3-methylene-3H-indole |
| Manual Xrefs | Databases |
|---|---|
| HMDB0011664 | HMDB |
| Registry Numbers | Sources |
|---|---|
| Reaxys:5860533 | Reaxys |
| CAS:40642-83-9 | ChemIDplus |