EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C9H6N2S2 |
| Net Charge | 0 |
| Average Mass | 206.295 |
| Monoisotopic Mass | 205.99724 |
| SMILES | Cc1c(N=C=S)cccc1N=C=S |
| InChI | InChI=1S/C9H6N2S2/c1-7-8(10-5-12)3-2-4-9(7)11-6-13/h2-4H,1H3 |
| InChIKey | AZXFPXMWSWRZLF-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | hapten Any substance capable of eliciting an immune response only when attached to a large carrier such as a protein. Examples include dinitrophenols; oligosaccharides; peptides; and heavy metals. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| toluene 2,6-diisothiocyanate (CHEBI:63898) has role hapten (CHEBI:59174) |
| toluene 2,6-diisothiocyanate (CHEBI:63898) is a toluene meta-diisothiocyanate (CHEBI:63897) |
| IUPAC Name |
|---|
| 1,3-diisothiocyanato-2-methylbenzene |
| Synonyms | Source |
|---|---|
| 1-methylbenzene-2,6-diisothiocyanate | ChEBI |
| 2,6-diisothiocyanatotoluene | ChEBI |
| 2,6-TITC | ChEBI |
| 2,6-toluenediisothiocyanate | ChEBI |
| 2,6-tolylene diisothiocyanate | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:2367268 | Reaxys |
| Citations |
|---|