EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C9H6N2S2 |
| Net Charge | 0 |
| Average Mass | 206.295 |
| Monoisotopic Mass | 205.99724 |
| SMILES | Cc1ccc(N=C=S)cc1N=C=S |
| InChI | InChI=1S/C9H6N2S2/c1-7-2-3-8(10-5-12)4-9(7)11-6-13/h2-4H,1H3 |
| InChIKey | NNMVCFPMIBOZCL-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | hapten Any substance capable of eliciting an immune response only when attached to a large carrier such as a protein. Examples include dinitrophenols; oligosaccharides; peptides; and heavy metals. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| toluene 2,4-diisothiocyanate (CHEBI:63896) has role hapten (CHEBI:59174) |
| toluene 2,4-diisothiocyanate (CHEBI:63896) is a toluene meta-diisothiocyanate (CHEBI:63897) |
| IUPAC Name |
|---|
| 2,4-diisothiocyanato-1-methylbenzene |
| Synonyms | Source |
|---|---|
| Isothiocyanic acid, 2,4-tolylene diester | ChemIDplus |
| 2,4-Tolylene diisothiocyanate | ChemIDplus |
| Isothiocyanic acid, 4-methyl-m-phenylene ester | ChemIDplus |
| 4-methyl-m-phenylene diisothiocyanate | ChEBI |
| 1-methylbenzene-2,4-diisothiocyanate | ChEBI |
| 2,4-toluene diisothiocyanate | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:2415812 | Reaxys |
| CAS:4891-66-1 | ChemIDplus |
| Citations |
|---|