EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H36O3 |
| Net Charge | 0 |
| Average Mass | 312.494 |
| Monoisotopic Mass | 312.26645 |
| SMILES | CC(C)CCCC(C)CCCC(C)CCC(=O)C(C)C(=O)O |
| InChI | InChI=1S/C19H36O3/c1-14(2)8-6-9-15(3)10-7-11-16(4)12-13-18(20)17(5)19(21)22/h14-17H,6-13H2,1-5H3,(H,21,22) |
| InChIKey | MVYSUTIAAQDMGB-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 3-oxopristanic acid (CHEBI:63891) is a 3-oxo fatty acid (CHEBI:134416) |
| 3-oxopristanic acid (CHEBI:63891) is a long-chain fatty acid (CHEBI:15904) |
| 3-oxopristanic acid (CHEBI:63891) is a methyl-branched fatty acid (CHEBI:62499) |
| Incoming Relation(s) |
| 3-oxopristanoyl-CoA (CHEBI:15371) has functional parent 3-oxopristanic acid (CHEBI:63891) |
| IUPAC Name |
|---|
| 2,6,10,14-tetramethyl-3-oxopentadecanoic acid |