EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C2H8N.NO3 |
| Net Charge | 0 |
| Average Mass | 108.097 |
| Monoisotopic Mass | 108.05349 |
| SMILES | CC[NH3+].O=[N+]([O-])[O-] |
| InChI | InChI=1S/C2H7N.NO3/c1-2-3;2-1(3)4/h2-3H2,1H3;/q;-1/p+1 |
| InChIKey | AHRQMWOXLCFNAV-UHFFFAOYSA-O |
| Roles Classification |
|---|
| Chemical Roles: | protic solvent A polar solvent that is capable of acting as a hydron (proton) donor. polar solvent A solvent that is composed of polar molecules. Polar solvents can dissolve ionic compounds or ionisable covalent compounds. |
| Applications: | protic solvent A polar solvent that is capable of acting as a hydron (proton) donor. polar solvent A solvent that is composed of polar molecules. Polar solvents can dissolve ionic compounds or ionisable covalent compounds. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| ethylammonium nitrate (CHEBI:63882) has part ethylaminium (CHEBI:566789) |
| ethylammonium nitrate (CHEBI:63882) has part nitrate (CHEBI:17632) |
| ethylammonium nitrate (CHEBI:63882) has role protic solvent (CHEBI:48356) |
| ethylammonium nitrate (CHEBI:63882) is a ionic liquid (CHEBI:63895) |
| ethylammonium nitrate (CHEBI:63882) is a organoammonium salt (CHEBI:46850) |
| IUPAC Name |
|---|
| ethanaminium nitrate |
| Synonyms | Source |
|---|---|
| ethylamine nitrate | SUBMITTER |
| EAN | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:3911152 | Reaxys |
| CAS:22113-86-6 | SUBMITTER |
| Citations |
|---|