EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C4H12NO2.NO3 |
| Net Charge | 0 |
| Average Mass | 168.149 |
| Monoisotopic Mass | 168.07462 |
| SMILES | O=[N+]([O-])[O-].OCC[NH2+]CCO |
| InChI | InChI=1S/C4H11NO2.NO3/c6-3-1-5-2-4-7;2-1(3)4/h5-7H,1-4H2;/q;-1/p+1 |
| InChIKey | NRUQNUIWEUZVLI-UHFFFAOYSA-O |
| Roles Classification |
|---|
| Chemical Roles: | protic solvent A polar solvent that is capable of acting as a hydron (proton) donor. polar solvent A solvent that is composed of polar molecules. Polar solvents can dissolve ionic compounds or ionisable covalent compounds. |
| Applications: | protic solvent A polar solvent that is capable of acting as a hydron (proton) donor. polar solvent A solvent that is composed of polar molecules. Polar solvents can dissolve ionic compounds or ionisable covalent compounds. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| diethanolammonium nitrate (CHEBI:63877) has part nitrate (CHEBI:17632) |
| diethanolammonium nitrate (CHEBI:63877) has role protic solvent (CHEBI:48356) |
| diethanolammonium nitrate (CHEBI:63877) is a ionic liquid (CHEBI:63895) |
| diethanolammonium nitrate (CHEBI:63877) is a organoammonium salt (CHEBI:46850) |
| IUPAC Name |
|---|
| 2-hydroxy-N-(2-hydroxyethyl)ethanaminium nitrate |
| Synonyms | Source |
|---|---|
| di-ethanolammonium nitrate | ChEBI |
| DEAN | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| US2007185330 | Patent |