EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C32H56N7O17P3S |
| Net Charge | 0 |
| Average Mass | 935.821 |
| Monoisotopic Mass | 935.26662 |
| SMILES | CC(C)CCCC(C)CCC(=O)SCCNC(=O)CCNC(=O)[C@H](O)C(C)(C)COP(=O)(O)OP(=O)(O)OC[C@H]1O[C@@H](n2cnc3c(N)ncnc32)[C@H](O)[C@@H]1OP(=O)(O)O |
| InChI | InChI=1S/C32H56N7O17P3S/c1-19(2)7-6-8-20(3)9-10-23(41)60-14-13-34-22(40)11-12-35-30(44)27(43)32(4,5)16-53-59(50,51)56-58(48,49)52-15-21-26(55-57(45,46)47)25(42)31(54-21)39-18-38-24-28(33)36-17-37-29(24)39/h17-21,25-27,31,42-43H,6-16H2,1-5H3,(H,34,40)(H,35,44)(H,48,49)(H,50,51)(H2,33,36,37)(H2,45,46,47)/t20?,21-,25-,26-,27+,31-/m1/s1 |
| InChIKey | YGNKJFPEXQCWDB-ANHZDMDASA-N |
| Roles Classification |
|---|
| Chemical Role: | acyl donor Any donor that can transfer acyl groups between molecular entities. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 4,8-dimethylnonanoyl-CoA (CHEBI:63856) has functional parent 4,8-dimethylnonanoic acid (CHEBI:63864) |
| 4,8-dimethylnonanoyl-CoA (CHEBI:63856) is a medium-chain fatty acyl-CoA (CHEBI:61907) |
| 4,8-dimethylnonanoyl-CoA (CHEBI:63856) is a multi-methyl-branched fatty acyl-CoA (CHEBI:18100) |
| 4,8-dimethylnonanoyl-CoA (CHEBI:63856) is conjugate acid of 4,8-dimethylnonanoyl-CoA(4-) (CHEBI:77061) |
| Incoming Relation(s) |
| 4,8-dimethylnonanoyl-CoA(4-) (CHEBI:77061) is conjugate base of 4,8-dimethylnonanoyl-CoA (CHEBI:63856) |
| Synonyms | Source |
|---|---|
| 4,8-dimethylnonanoyl-Coenzyme A | ChEBI |
| S-(4,8-dimethylnonanoate)coenzyme A | CAS |
| Manual Xrefs | Databases |
|---|---|
| LMFA07050260 | LIPID MAPS |
| Registry Numbers | Sources |
|---|---|
| CAS:204120-61-6 | CAS |