EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C26H40O5 |
| Net Charge | 0 |
| Average Mass | 432.601 |
| Monoisotopic Mass | 432.28757 |
| SMILES | CC(C)OC(=O)CCC/C=C\C[C@@H]1[C@@H](CC[C@@H](O)CCc2ccccc2)[C@H](O)C[C@@H]1O |
| InChI | InChI=1S/C26H40O5/c1-19(2)31-26(30)13-9-4-3-8-12-22-23(25(29)18-24(22)28)17-16-21(27)15-14-20-10-6-5-7-11-20/h3,5-8,10-11,19,21-25,27-29H,4,9,12-18H2,1-2H3/b8-3-/t21-,22+,23+,24-,25+/m0/s1 |
| InChIKey | GGXICVAJURFBLW-CEYXHVGTSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Role: | EC 4.2.1.1 (carbonic anhydrase) inhibitor An EC 4.2.1.* (hydro-lyases) inhibitor that interferes with the action of carbonic anhydrase (EC 4.2.1.1). Such compounds reduce the secretion of H+ ions by the proximal kidney tubule. |
| Applications: | antiglaucoma drug Any drug which can be used to prevent or alleviate glaucoma, a disease in which the optic nerve is damaged, resulting in progressive, irreversible loss of vision. It is often, though not always, associated with increased pressure of the fluid in the eye. prodrug A compound that, on administration, must undergo chemical conversion by metabolic processes before becoming the pharmacologically active drug for which it is a prodrug. antihypertensive agent Any drug used in the treatment of acute or chronic vascular hypertension regardless of pharmacological mechanism. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| latanoprost (CHEBI:6384) has functional parent latanoprost free acid (CHEBI:63925) |
| latanoprost (CHEBI:6384) has role antiglaucoma drug (CHEBI:39456) |
| latanoprost (CHEBI:6384) has role antihypertensive agent (CHEBI:35674) |
| latanoprost (CHEBI:6384) has role EC 4.2.1.1 (carbonic anhydrase) inhibitor (CHEBI:23018) |
| latanoprost (CHEBI:6384) has role prodrug (CHEBI:50266) |
| latanoprost (CHEBI:6384) is a isopropyl ester (CHEBI:35725) |
| latanoprost (CHEBI:6384) is a prostaglandins Fα (CHEBI:36066) |
| latanoprost (CHEBI:6384) is a triol (CHEBI:27136) |
| IUPAC Name |
|---|
| isopropyl (5Z,9α,11α,15R)-9,11,15-trihydroxy-17-phenyl-18,19,20-trinorprost-5-en-1-oate |
| INNs | Source |
|---|---|
| latanoprost | WHO MedNet |
| latanoprost | WHO MedNet |
| latanoprost | WHO MedNet |
| latanoprostum | WHO MedNet |
| Synonyms | Source |
|---|---|
| isopropyl (Z)-7-((1R,2R,3R,5S)-3,5-dihydroxy-2-((3R)-3-hydroxy-5-phenylpentyl)cyclopentyl)-5-heptenoate | ChemIDplus |
| PhXA 41 | ChemIDplus |
| propan-2-yl (5Z)-7-{(1R,2R,3R,5S)-3,5-dihydroxy-2-[(3R)-3-hydroxy-5-phenylpentyl]cyclopentyl}hept-5-enoate | IUPAC |
| Xalatan | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| 1551 | DrugCentral |
| D00356 | KEGG DRUG |
| DB00654 | DrugBank |
| HMDB0014792 | HMDB |
| Latanoprost | Wikipedia |
| Registry Numbers | Sources |
|---|---|
| Reaxys:5912370 | Reaxys |
| CAS:130209-82-4 | ChemIDplus |
| Citations |
|---|