EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C27H44O3 |
| Net Charge | 0 |
| Average Mass | 416.646 |
| Monoisotopic Mass | 416.32905 |
| SMILES | [H][C@]12CC[C@@]3(C)[C@@]([H])(CC[C@]3([H])[C@H](C)CC[C@H](O)C(C)C)[C@]1([H])[C@H](O)CC1=CC(=O)CC[C@@]12C |
| InChI | InChI=1S/C27H44O3/c1-16(2)23(29)9-6-17(3)20-7-8-21-25-22(11-13-27(20,21)5)26(4)12-10-19(28)14-18(26)15-24(25)30/h14,16-17,20-25,29-30H,6-13,15H2,1-5H3/t17-,20-,21+,22+,23+,24-,25+,26+,27-/m1/s1 |
| InChIKey | LFFHZNXDGBQZCO-GXKBHXPCSA-N |
| Roles Classification |
|---|
| Biological Role: | bile acid metabolite Metabolites of bile acids, four-ringed steroid acids formed along the cholesterol degradation pathway. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (24S)-7α,24-dihydroxycholest-4-en-3-one (CHEBI:63838) is a 7α,24-dihydroxycholest-4-en-3-one (CHEBI:48701) |
| IUPAC Name |
|---|
| (24S)-7α,24-dihydroxycholest-4-en-3-one |
| Synonym | Source |
|---|---|
| 4-cholesten-7α,24(S)-diol-3-one | IUPAC |
| UniProt Name | Source |
|---|---|
| (24S)-7α,24-dihydroxycholest-4-en-3-one | UniProt |