EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C27H48O5 |
| Net Charge | 0 |
| Average Mass | 452.676 |
| Monoisotopic Mass | 452.35017 |
| SMILES | [H][C@@]12C[C@H](O)CC[C@]1(C)[C@@]1([H])C[C@H](O)[C@@]3(C)[C@@]([H])(CC[C@]3([H])[C@H](C)CC[C@H](O)C(C)CO)[C@]1([H])[C@H](O)C2 |
| InChI | InChI=1S/C27H48O5/c1-15(5-8-22(30)16(2)14-28)19-6-7-20-25-21(13-24(32)27(19,20)4)26(3)10-9-18(29)11-17(26)12-23(25)31/h15-25,28-32H,5-14H2,1-4H3/t15-,16?,17+,18-,19-,20+,21+,22+,23-,24+,25+,26+,27-/m1/s1 |
| InChIKey | CPKBPCHJXMSTOE-CJKJGBPISA-N |
| Roles Classification |
|---|
| Biological Role: | bile acid metabolite Metabolites of bile acids, four-ringed steroid acids formed along the cholesterol degradation pathway. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (24S)-5β-cholestane-3α,7α,12α,24,26-pentol (CHEBI:63835) is a 5β-cholestane-3α,7α,12α,24,26-pentol (CHEBI:48732) |
| IUPAC Name |
|---|
| (24S)-5β-cholestane-3α,7α,12α,24,26-pentol |
| Synonym | Source |
|---|---|
| 5β-cholestan-3α,7α,12α,24(S),27-pentol | ChEBI |