EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C27H46O4 |
| Net Charge | 0 |
| Average Mass | 434.661 |
| Monoisotopic Mass | 434.33961 |
| SMILES | [H][C@@]12CC(=O)CC[C@]1(C)[C@@]1([H])C[C@H](O)[C@@]3(C)[C@@]([H])(CC[C@]3([H])[C@H](C)CC[C@H](O)C(C)C)[C@]1([H])[C@H](O)C2 |
| InChI | InChI=1S/C27H46O4/c1-15(2)22(29)9-6-16(3)19-7-8-20-25-21(14-24(31)27(19,20)5)26(4)11-10-18(28)12-17(26)13-23(25)30/h15-17,19-25,29-31H,6-14H2,1-5H3/t16-,17+,19-,20+,21+,22+,23-,24+,25+,26+,27-/m1/s1 |
| InChIKey | OESDJUYDQFBVDE-ZFUXDIRQSA-N |
| Roles Classification |
|---|
| Biological Role: | bile acid metabolite Metabolites of bile acids, four-ringed steroid acids formed along the cholesterol degradation pathway. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (24S)-7α,12α,24-trihydroxy-5β-cholestan-3-one (CHEBI:63830) is a 7α,12α,24-trihydroxy-5β-cholestan-3-one (CHEBI:48715) |
| IUPAC Name |
|---|
| (24S)-7α,12α,24-trihydroxy-5β-cholestan-3-one |
| Synonym | Source |
|---|---|
| 5β-cholestan-7α,12α,24(S)-triol-3-one | ChEBI |