EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C26H29NO2 |
| Net Charge | 0 |
| Average Mass | 387.523 |
| Monoisotopic Mass | 387.21983 |
| SMILES | CC/C(=C(\c1ccccc1)c1ccc(OCC[N+](C)(C)[O-])cc1)c1ccccc1 |
| InChI | InChI=1S/C26H29NO2/c1-4-25(21-11-7-5-8-12-21)26(22-13-9-6-10-14-22)23-15-17-24(18-16-23)29-20-19-27(2,3)28/h5-18H,4,19-20H2,1-3H3/b26-25- |
| InChIKey | YAASNACECBQAFW-QPLCGJKRSA-N |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| Application: | anti-estrogen A drug which acts to reduce estrogenic activity in the body, either by reducing the amount of estrogen or by reducing the activity of whatever estrogen is present. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| tamoxifen N-oxide (CHEBI:63825) has functional parent tamoxifen (CHEBI:41774) |
| tamoxifen N-oxide (CHEBI:63825) has parent hydride stilbene (CHEBI:26775) |
| tamoxifen N-oxide (CHEBI:63825) has role anti-estrogen (CHEBI:50751) |
| tamoxifen N-oxide (CHEBI:63825) has role metabolite (CHEBI:25212) |
| tamoxifen N-oxide (CHEBI:63825) is a aromatic ether (CHEBI:35618) |
| tamoxifen N-oxide (CHEBI:63825) is a tertiary amine oxide (CHEBI:134363) |
| IUPAC Name |
|---|
| (2-{4-[(1Z)-1,2-diphenylbut-1-en-1-yl]phenoxy}ethyl)dimethylamine oxide |
| Manual Xrefs | Databases |
|---|---|
| C16545 | KEGG COMPOUND |
| Registry Numbers | Sources |
|---|---|
| Reaxys:8504138 | Reaxys |
| CAS:75504-34-6 | ChemIDplus |
| CAS:75504-34-6 | KEGG COMPOUND |
| Citations |
|---|