EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C27H46O6 |
| Net Charge | 0 |
| Average Mass | 466.659 |
| Monoisotopic Mass | 466.32944 |
| SMILES | [H][C@@]12C[C@H](O)CC[C@]1(C)[C@@]1([H])C[C@H](O)[C@@]3(C)[C@@]([H])(CC[C@]3([H])[C@H](C)CC[C@H](O)C(C)C(=O)O)[C@]1([H])[C@H](O)C2 |
| InChI | InChI=1S/C27H46O6/c1-14(5-8-21(29)15(2)25(32)33)18-6-7-19-24-20(13-23(31)27(18,19)4)26(3)10-9-17(28)11-16(26)12-22(24)30/h14-24,28-31H,5-13H2,1-4H3,(H,32,33)/t14-,15?,16+,17-,18-,19+,20+,21+,22-,23+,24+,26+,27-/m1/s1 |
| InChIKey | FAYYTQMQTAKHRM-ASDSSCPRSA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | bile acid metabolite Metabolites of bile acids, four-ringed steroid acids formed along the cholesterol degradation pathway. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (24S)-3α,7α,12α,24-tetrahydroxy-5β-cholestan-26-oic acid (CHEBI:63820) is a 3α,7α,12α,24-tetrahydroxy-5β-cholestan-26-oic acid (CHEBI:48742) |
| (24S)-3α,7α,12α,24-tetrahydroxy-5β-cholestan-26-oic acid (CHEBI:63820) is conjugate acid of (24S)-3α,7α,12α,24-tetrahydroxy-5β-cholestan-26-oate (CHEBI:63824) |
| Incoming Relation(s) |
| (24S)-3α,7α,12α,24-tetrahydroxy-5β-cholestan-26-oate (CHEBI:63824) is conjugate base of (24S)-3α,7α,12α,24-tetrahydroxy-5β-cholestan-26-oic acid (CHEBI:63820) |
| IUPAC Name |
|---|
| (24S)-3α,7α,12α,24-tetrahydroxy-5β-cholestan-26-oic acid |
| Synonym | Source |
|---|---|
| tetraHCA | ChEBI |