EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H12N2O3 |
| Net Charge | 0 |
| Average Mass | 268.272 |
| Monoisotopic Mass | 268.08479 |
| SMILES | O=C1NC(=O)C(c2ccccc2)(c2ccc(O)cc2)N1 |
| InChI | InChI=1S/C15H12N2O3/c18-12-8-6-11(7-9-12)15(10-4-2-1-3-5-10)13(19)16-14(20)17-15/h1-9,18H,(H2,16,17,19,20) |
| InChIKey | XEEDURHPFVXALT-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 4-hydroxyphenytoin (CHEBI:63804) has functional parent hydantoin (CHEBI:27612) |
| 4-hydroxyphenytoin (CHEBI:63804) has role metabolite (CHEBI:25212) |
| 4-hydroxyphenytoin (CHEBI:63804) is a imidazolidine-2,4-dione (CHEBI:24628) |
| 4-hydroxyphenytoin (CHEBI:63804) is a phenols (CHEBI:33853) |
| IUPAC Name |
|---|
| 5-(4-hydroxyphenyl)-5-phenylimidazolidine-2,4-dione |
| Synonyms | Source |
|---|---|
| 4-Hydroxydiphenylhydantoin | ChemIDplus |
| p-Hydroxyphenytoin | ChemIDplus |
| para-Hydroxyphenytoin | ChemIDplus |
| Hydroxyphenytoin | ChemIDplus |
| (Hydroxyphenyl)phenylhydantoin | ChemIDplus |
| (p-Hydroxyphenyl)phenylhydantoin | ChemIDplus |
| Registry Numbers | Sources |
|---|---|
| Reaxys:89178 | Reaxys |
| CAS:2784-27-2 | ChemIDplus |
| Citations |
|---|