EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C8H8O4 |
| Net Charge | 0 |
| Average Mass | 168.148 |
| Monoisotopic Mass | 168.04226 |
| SMILES | COc1ccc(C(=O)O)cc1O |
| InChI | InChI=1S/C8H8O4/c1-12-7-3-2-5(8(10)11)4-6(7)9/h2-4,9H,1H3,(H,10,11) |
| InChIKey | LBKFGYZQBSGRHY-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | antibacterial agent A substance (or active part thereof) that kills or slows the growth of bacteria. plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 3-hydroxy-4-methoxybenzoic acid (CHEBI:63798) has role antibacterial agent (CHEBI:33282) |
| 3-hydroxy-4-methoxybenzoic acid (CHEBI:63798) has role plant metabolite (CHEBI:76924) |
| 3-hydroxy-4-methoxybenzoic acid (CHEBI:63798) is a methoxybenzoic acid (CHEBI:25238) |
| 3-hydroxy-4-methoxybenzoic acid (CHEBI:63798) is a monohydroxybenzoic acid (CHEBI:25389) |
| 3-hydroxy-4-methoxybenzoic acid (CHEBI:63798) is conjugate acid of 3-hydroxy-4-methoxybenzoate (CHEBI:63797) |
| Incoming Relation(s) |
| bis(trimethylsilyl)isovanillate (CHEBI:88177) has functional parent 3-hydroxy-4-methoxybenzoic acid (CHEBI:63798) |
| 3-hydroxy-4-methoxybenzoate (CHEBI:63797) is conjugate base of 3-hydroxy-4-methoxybenzoic acid (CHEBI:63798) |
| IUPAC Name |
|---|
| 3-hydroxy-4-methoxybenzoic acid |
| Synonyms | Source |
|---|---|
| Acide isovanillique | ChemIDplus |
| Isovanillic acid | ChemIDplus |
| 3-Hydroxyanisic acid | ChemIDplus |
| 3-hydroxy-p-anisic acid | NIST Chemistry WebBook |
| Manual Xrefs | Databases |
|---|---|
| HMDB0060003 | HMDB |
| Citations |
|---|