EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C13H13N3O3 |
| Net Charge | 0 |
| Average Mass | 259.265 |
| Monoisotopic Mass | 259.09569 |
| SMILES | Nc1cccc2c1CN(C1CCC(=O)NC1=O)C2=O |
| InChI | InChI=1S/C13H13N3O3/c14-9-3-1-2-7-8(9)6-16(13(7)19)10-4-5-11(17)15-12(10)18/h1-3,10H,4-6,14H2,(H,15,17,18) |
| InChIKey | GOTYRUGSSMKFNF-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Roles: | anti-HIV agent An antiviral agent that destroys or inhibits the replication of the human immunodeficiency virus. immunomodulator Biologically active substance whose activity affects or plays a role in the functioning of the immune system. analgesic An agent capable of relieving pain without the loss of consciousness or without producing anaesthesia. In addition, analgesic is a role played by a compound which is exhibited by a capability to cause a reduction of pain symptoms. |
| Applications: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. antifibrotic agent Any agent which acts to reduce fibrosis. angiogenesis inhibitor An agent and endogenous substances that antagonize or inhibit the development of new blood vessels. anti-anaemic agent A compound which increases either the number of red cells or the amount of haemoglobin in the blood. immunomodulator Biologically active substance whose activity affects or plays a role in the functioning of the immune system. analgesic An agent capable of relieving pain without the loss of consciousness or without producing anaesthesia. In addition, analgesic is a role played by a compound which is exhibited by a capability to cause a reduction of pain symptoms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| lenalidomide (CHEBI:63791) has role analgesic (CHEBI:35480) |
| lenalidomide (CHEBI:63791) has role angiogenesis inhibitor (CHEBI:48422) |
| lenalidomide (CHEBI:63791) has role anti-anaemic agent (CHEBI:75835) |
| lenalidomide (CHEBI:63791) has role anti-HIV agent (CHEBI:64946) |
| lenalidomide (CHEBI:63791) has role antifibrotic agent (CHEBI:233423) |
| lenalidomide (CHEBI:63791) has role antineoplastic agent (CHEBI:35610) |
| lenalidomide (CHEBI:63791) has role immunomodulator (CHEBI:50846) |
| lenalidomide (CHEBI:63791) is a aromatic amine (CHEBI:33860) |
| lenalidomide (CHEBI:63791) is a dicarboximide (CHEBI:35356) |
| lenalidomide (CHEBI:63791) is a isoindoles (CHEBI:24897) |
| lenalidomide (CHEBI:63791) is a piperidones (CHEBI:48589) |
| IUPAC Name |
|---|
| 3-(4-amino-1-oxo-1,3-dihydro-2H-isoindol-2-yl)piperidine-2,6-dione |
| INNs | Source |
|---|---|
| lenalidomida | WHO MedNet |
| lenalidomide | KEGG DRUG |
| Synonyms | Source |
|---|---|
| 1-oxo-2-(2,6-dioxopiperidin-3-yl)-4-aminoisoindoline | ChEBI |
| 3-(4-Amino-1-oxoisoindolin-2-yl)piperidine-2,6-dione | ChemIDplus |
| CC-5013 | ChEMBL |
| CDC-501 | ChEMBL |
| NSC-747972 | ChEMBL |
| SYP-1512 | ChEMBL |
| Brand Names | Source |
|---|---|
| Lenalidomide accord | ChEMBL |
| Lenalidomide mylan | ChEMBL |
| Revlimid | KEGG DRUG |
| Manual Xrefs | Databases |
|---|---|
| 3317 | DrugCentral |
| D04687 | KEGG DRUG |
| DB00480 | DrugBank |
| Lenalidomide | Wikipedia |
| LSM-6187 | LINCS |
| Registry Numbers | Sources |
|---|---|
| Reaxys:8335210 | Reaxys |
| CAS:191732-72-6 | ChemIDplus |
| Citations |
|---|