EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C13H13N3O3 |
| Net Charge | 0 |
| Average Mass | 259.265 |
| Monoisotopic Mass | 259.09569 |
| SMILES | Nc1cccc2c1CN(C1CCC(=O)NC1=O)C2=O |
| InChI | InChI=1S/C13H13N3O3/c14-9-3-1-2-7-8(9)6-16(13(7)19)10-4-5-11(17)15-12(10)18/h1-3,10H,4-6,14H2,(H,15,17,18) |
| InChIKey | GOTYRUGSSMKFNF-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | immunomodulator Biologically active substance whose activity affects or plays a role in the functioning of the immune system. |
| Applications: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. immunomodulator Biologically active substance whose activity affects or plays a role in the functioning of the immune system. angiogenesis inhibitor An agent and endogenous substances that antagonize or inhibit the development of new blood vessels. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| lenalidomide (CHEBI:63791) has role angiogenesis inhibitor (CHEBI:48422) |
| lenalidomide (CHEBI:63791) has role antineoplastic agent (CHEBI:35610) |
| lenalidomide (CHEBI:63791) has role immunomodulator (CHEBI:50846) |
| lenalidomide (CHEBI:63791) is a aromatic amine (CHEBI:33860) |
| lenalidomide (CHEBI:63791) is a dicarboximide (CHEBI:35356) |
| lenalidomide (CHEBI:63791) is a isoindoles (CHEBI:24897) |
| lenalidomide (CHEBI:63791) is a piperidones (CHEBI:48589) |
| IUPAC Name |
|---|
| 3-(4-amino-1-oxo-1,3-dihydro-2H-isoindol-2-yl)piperidine-2,6-dione |
| INN | Source |
|---|---|
| lenalidomide | KEGG DRUG |
| Synonyms | Source |
|---|---|
| 1-oxo-2-(2,6-dioxopiperidin-3-yl)-4-aminoisoindoline | ChEBI |
| 3-(4-Amino-1-oxoisoindolin-2-yl)piperidine-2,6-dione | ChemIDplus |
| Brand Name | Source |
|---|---|
| Revlimid | KEGG DRUG |
| Manual Xrefs | Databases |
|---|---|
| 3317 | DrugCentral |
| D04687 | KEGG DRUG |
| DB00480 | DrugBank |
| Lenalidomide | Wikipedia |
| LSM-6187 | LINCS |
| Registry Numbers | Sources |
|---|---|
| Reaxys:8335210 | Reaxys |
| CAS:191732-72-6 | ChemIDplus |
| Citations |
|---|