EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C21H30O3 |
| Net Charge | 0 |
| Average Mass | 330.468 |
| Monoisotopic Mass | 330.21949 |
| SMILES | CC[C@H]1[C@H](C(C)C)c2cc(C(=O)CCC(=O)O)c(C)cc2C1(C)C |
| InChI | InChI=1S/C21H30O3/c1-7-16-20(12(2)3)15-11-14(18(22)8-9-19(23)24)13(4)10-17(15)21(16,5)6/h10-12,16,20H,7-9H2,1-6H3,(H,23,24)/t16-,20+/m0/s1 |
| InChIKey | ZNQKOOLQBLAKFY-OXJNMPFZSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (S,S)-trans-2-ethyl-1-isopropyl-3,3,5-trimethyl-6-succinylindane (CHEBI:63787) is a 4-oxo monocarboxylic acid (CHEBI:35950) |
| (S,S)-trans-2-ethyl-1-isopropyl-3,3,5-trimethyl-6-succinylindane (CHEBI:63787) is a indanes (CHEBI:46940) |
| Citations |
|---|