EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H26O3 |
| Net Charge | 0 |
| Average Mass | 302.414 |
| Monoisotopic Mass | 302.18819 |
| SMILES | Cc1cc2c(cc1C(=O)CCC(=O)O)[C@@H](C(C)C)CC2(C)C |
| InChI | InChI=1S/C19H26O3/c1-11(2)15-10-19(4,5)16-8-12(3)13(9-14(15)16)17(20)6-7-18(21)22/h8-9,11,15H,6-7,10H2,1-5H3,(H,21,22)/t15-/m1/s1 |
| InChIKey | IFOMWRGNIWRMKJ-OAHLLOKOSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (R)-1-isopropyl-3,3,5-trimethyl-6-succinylindane (CHEBI:63783) is a 4-oxo monocarboxylic acid (CHEBI:35950) |
| (R)-1-isopropyl-3,3,5-trimethyl-6-succinylindane (CHEBI:63783) is a indanes (CHEBI:46940) |
| IUPAC Name |
|---|
| 4-oxo-4-[(3R)-1,1,6-trimethyl-3-(propan-2-yl)-2,3-dihydro-1H-inden-5-yl]butanoic acid |
| Citations |
|---|