EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C18H26O |
| Net Charge | 0 |
| Average Mass | 258.405 |
| Monoisotopic Mass | 258.19837 |
| SMILES | CC(=O)c1cc2c(cc1C)C(C)(C)C(C)C2C(C)C |
| InChI | InChI=1S/C18H26O/c1-10(2)17-12(4)18(6,7)16-8-11(3)14(13(5)19)9-15(16)17/h8-10,12,17H,1-7H3 |
| InChIKey | IMRYETFJNLKUHK-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | odorant receptor agonist An agonist that selectively binds to and activates an odorant receptor. |
| Application: | fragrance A substance, extract, or preparation for diffusing or imparting an agreeable or attractive smell. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| traseolide (CHEBI:63781) has role fragrance (CHEBI:48318) |
| traseolide (CHEBI:63781) has role odorant receptor agonist (CHEBI:62873) |
| traseolide (CHEBI:63781) is a aromatic ketone (CHEBI:76224) |
| traseolide (CHEBI:63781) is a indanes (CHEBI:46940) |
| traseolide (CHEBI:63781) is a methyl ketone (CHEBI:51867) |
| Incoming Relation(s) |
| (S,S)-trans-1-isopropyl-2,3,3,5-tetramethyl-6-succinylindane (CHEBI:46099) has functional parent traseolide (CHEBI:63781) |
| (S,S)-traseolide (CHEBI:63780) is a traseolide (CHEBI:63781) |
| IUPAC Name |
|---|
| 1-[1,1,2,6-tetramethyl-3-(propan-2-yl)-2,3-dihydro-1H-inden-5-yl]ethanone |
| Registry Numbers | Sources |
|---|---|
| CAS:68140-48-7 | ChemIDplus |
| CAS:68140-48-7 | NIST Chemistry WebBook |
| Citations |
|---|