EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H33NO2 |
| Net Charge | 0 |
| Average Mass | 271.445 |
| Monoisotopic Mass | 271.25113 |
| SMILES | CCCCCCCCCCCCCCC(N)C(=O)O |
| InChI | InChI=1S/C16H33NO2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15(17)16(18)19/h15H,2-14,17H2,1H3,(H,18,19) |
| InChIKey | XELWBYCKQCNAGY-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2-aminohexadecanoic acid (CHEBI:63776) is a α-amino fatty acid (CHEBI:59755) |
| IUPAC Name |
|---|
| 2-aminohexadecanoic acid |
| Synonyms | Source |
|---|---|
| 2-aminopalmitic acid | ChEBI |
| C16 Laa | ChEBI |
| C16 lipoamino acid | ChEBI |
| α-aminopalmitic acid | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| LMFA01100018 | LIPID MAPS |
| Registry Numbers | Sources |
|---|---|
| Reaxys:1785113 | Reaxys |
| Citations |
|---|