EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C17H21NO5 |
| Net Charge | 0 |
| Average Mass | 319.357 |
| Monoisotopic Mass | 319.14197 |
| SMILES | CC(=O)CC(=O)CCc1ccc(NC(=O)CCCC(=O)O)cc1 |
| InChI | InChI=1S/C17H21NO5/c1-12(19)11-15(20)10-7-13-5-8-14(9-6-13)18-16(21)3-2-4-17(22)23/h5-6,8-9H,2-4,7,10-11H2,1H3,(H,18,21)(H,22,23) |
| InChIKey | KWUITAARNKUOMJ-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | hapten Any substance capable of eliciting an immune response only when attached to a large carrier such as a protein. Examples include dinitrophenols; oligosaccharides; peptides; and heavy metals. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 4-[4-(3,5-dioxohexyl)phenylcarbamoyl]butyric acid (CHEBI:63773) has functional parent butyric acid (CHEBI:30772) |
| 4-[4-(3,5-dioxohexyl)phenylcarbamoyl]butyric acid (CHEBI:63773) has role hapten (CHEBI:59174) |
| 4-[4-(3,5-dioxohexyl)phenylcarbamoyl]butyric acid (CHEBI:63773) is a β-diketone (CHEBI:67265) |
| IUPAC Name |
|---|
| 5-{[4-(3,5-dioxohexyl)phenyl]amino}-5-oxopentanoic acid |
| Registry Numbers | Sources |
|---|---|
| Reaxys:14611056 | Reaxys |
| Citations |
|---|