EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C18H15N5O6S2 |
| Net Charge | 0 |
| Average Mass | 461.481 |
| Monoisotopic Mass | 461.04638 |
| SMILES | COc1nccnc1NS(=O)(=O)c1ccc(NC(=O)/C=C/c2ccc([N+](=O)[O-])s2)cc1 |
| InChI | InChI=1S/C18H15N5O6S2/c1-29-18-17(19-10-11-20-18)22-31(27,28)14-6-2-12(3-7-14)21-15(24)8-4-13-5-9-16(30-13)23(25)26/h2-11H,1H3,(H,19,22)(H,21,24)/b8-4+ |
| InChIKey | FNPPHVLYVGMZMZ-XBXARRHUSA-N |
| Roles Classification |
|---|
| Biological Role: | necroptosis inhibitor Any substance that inhibits the process of necroptosis (programmed form of necrosis) in organisms. |
| Application: | neuroprotective agent Any compound that can be used for the treatment of neurodegenerative disorders. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| necrosulfonamide (CHEBI:63770) has role necroptosis inhibitor (CHEBI:167704) |
| necrosulfonamide (CHEBI:63770) has role neuroprotective agent (CHEBI:63726) |
| necrosulfonamide (CHEBI:63770) is a pyrazines (CHEBI:38314) |
| necrosulfonamide (CHEBI:63770) is a sulfonamide (CHEBI:35358) |
| necrosulfonamide (CHEBI:63770) is a thiophenes (CHEBI:26961) |
| IUPAC Name |
|---|
| (2E)-N-{4-[(3-methoxypyrazin-2-yl)sulfamoyl]phenyl}-3-(5-nitrothiophen-2-yl)prop-2-enamide |
| Synonym | Source |
|---|---|
| (E)-N-(4-(N-(3-methoxypyrazin-2-yl)sulfamoyl)phenyl)-3-(5-nitrothiophene-2-yl)acrylamide | ChEBI |
| Citations |
|---|