EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H14O3 |
| Net Charge | 0 |
| Average Mass | 242.274 |
| Monoisotopic Mass | 242.09429 |
| SMILES | CC(C)=CCC1=C(O)C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C15H14O3/c1-9(2)7-8-12-13(16)10-5-3-4-6-11(10)14(17)15(12)18/h3-7,18H,8H2,1-2H3 |
| InChIKey | CIEYTVIYYGTCCI-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Abutilon pakistanicum (IPNI:323558-2) | whole plant (BTO:0001461) | DOI (10.1002/hlca.201000075) | |
| Tabebuia avellanedae (IPNI:110853-1) | - | DOI (10.3998/ark.5550190.0008.204) |
| Roles Classification |
|---|
| Biological Roles: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. antibacterial agent A substance (or active part thereof) that kills or slows the growth of bacteria. |
| Applications: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. anti-inflammatory agent Any compound that has anti-inflammatory effects. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| lapachol (CHEBI:6377) has role anti-inflammatory agent (CHEBI:67079) |
| lapachol (CHEBI:6377) has role antibacterial agent (CHEBI:33282) |
| lapachol (CHEBI:6377) has role antineoplastic agent (CHEBI:35610) |
| lapachol (CHEBI:6377) has role plant metabolite (CHEBI:76924) |
| lapachol (CHEBI:6377) is a hydroxy-1,4-naphthoquinone (CHEBI:132157) |
| lapachol (CHEBI:6377) is a olefinic compound (CHEBI:78840) |
| IUPAC Name |
|---|
| 2-hydroxy-3-(3-methylbut-2-en-1-yl)naphthalene-1,4-dione |
| Synonyms | Source |
|---|---|
| 2-hydroxy-3-(3-methyl-2-buten-1-yl)-1,4-naphthalenedione | ChEBI |
| 2-hydroxy-3-(3-methyl-2-butenyl)-1,4-naphthalenedione | ChEBI |
| 2-hydroxy-3-(3-methyl-2-butenyl)-1,4-naphthoquinone | ChemIDplus |
| 2-hydroxy-3-(3-methylbut-2-en-1-yl)-1,4-dihydronaphthalene-1,4-dione | ChEBI |
| Bethabarra wood | ChemIDplus |
| C.I. 75490 | ChemIDplus |
| Citations |
|---|