EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C6H11O4 |
| Net Charge | 0 |
| Average Mass | 147.150 |
| Monoisotopic Mass | 147.06573 |
| SMILES | *[C@@H]1O[C@@H](C)[C@@H](O)[C@@H](O)[C@@H]1O |
| Roles Classification |
|---|
| Biological Roles: | carbohydrate allergen Any carbohydrate, carbohydrate derivative or derived substituent group which causes the onset of an allergic reaction. epitope The biological role played by a material entity when bound by a receptor of the adaptive immune system. Specific site on an antigen to which an antibody binds. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| α-L-fucosyl group (CHEBI:63760) has role carbohydrate allergen (CHEBI:143231) |
| α-L-fucosyl group (CHEBI:63760) has role epitope (CHEBI:53000) |
| α-L-fucosyl group (CHEBI:63760) is a fucosyl group (CHEBI:62688) |
| Incoming Relation(s) |
| α-L-Fuc-(1→2)-β-D-Gal-(1→3)-β-D-GlcNAc-(1→3)-α-D-Gal-yl group (CHEBI:140180) has part α-L-fucosyl group (CHEBI:63760) |
| Citations |
|---|