EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C6H11O4 |
| Net Charge | 0 |
| Average Mass | 147.150 |
| Monoisotopic Mass | 147.06573 |
| SMILES | *[C@@H]1O[C@@H](C)[C@@H](O)[C@@H](O)[C@@H]1O |
| Roles Classification |
|---|
| Biological Roles: | epitope The biological role played by a material entity when bound by a receptor of the adaptive immune system. Specific site on an antigen to which an antibody binds. carbohydrate allergen Any carbohydrate, carbohydrate derivative or derived substituent group which causes the onset of an allergic reaction. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| α-L-fucosyl group (CHEBI:63760) has role carbohydrate allergen (CHEBI:143231) |
| α-L-fucosyl group (CHEBI:63760) has role epitope (CHEBI:53000) |
| α-L-fucosyl group (CHEBI:63760) is a fucosyl group (CHEBI:62688) |
| Incoming Relation(s) |
| α-L-Fuc-(1→2)-β-D-Gal-(1→3)-β-D-GlcNAc-(1→3)-α-D-Gal-yl group (CHEBI:140180) has part α-L-fucosyl group (CHEBI:63760) |
| Citations |
|---|