EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C5H9O4 |
| Net Charge | 0 |
| Average Mass | 133.123 |
| Monoisotopic Mass | 133.05008 |
| SMILES | *[C@@H]1OC[C@@H](O)[C@H](O)[C@H]1O |
| Roles Classification |
|---|
| Biological Role: | carbohydrate allergen Any carbohydrate, carbohydrate derivative or derived substituent group which causes the onset of an allergic reaction. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| β-D-xylosyl group (CHEBI:63758) has role carbohydrate allergen (CHEBI:143231) |
| β-D-xylosyl group (CHEBI:63758) is a xylosyl group (CHEBI:63759) |
| β-D-xylosyl group (CHEBI:63758) is substituent group from β-D-xylose (CHEBI:28161) |
| Citations |
|---|