EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H36O7P2 |
| Net Charge | 0 |
| Average Mass | 450.449 |
| Monoisotopic Mass | 450.19363 |
| SMILES | [H][C@@]12CC=C(C)[C@H](CC/C(C)=C/COP(=O)(O)OP(=O)(O)O)[C@@]1(C)CCCC2(C)C |
| InChI | InChI=1S/C20H36O7P2/c1-15(11-14-26-29(24,25)27-28(21,22)23)7-9-17-16(2)8-10-18-19(3,4)12-6-13-20(17,18)5/h8,11,17-18H,6-7,9-10,12-14H2,1-5H3,(H,24,25)(H2,21,22,23)/b15-11+/t17-,18-,20+/m0/s1 |
| InChIKey | CYXMSAANDYUEKO-ATPOGHATSA-N |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (5S,9S,10S,13E)-labda-7,13-dien-15-yl diphosphate (CHEBI:63750) is a diterpenyl phosphate (CHEBI:36772) |
| (5S,9S,10S,13E)-labda-7,13-dien-15-yl diphosphate (CHEBI:63750) is a labdane diterpenoid (CHEBI:36770) |
| (5S,9S,10S,13E)-labda-7,13-dien-15-yl diphosphate (CHEBI:63750) is conjugate acid of (5S,9S,10S,13E)-labda-7,13-dien-15-yl diphosphate(3−) (CHEBI:63682) |
| Incoming Relation(s) |
| (5S,9S,10S,13E)-labda-7,13-dien-15-yl diphosphate(3−) (CHEBI:63682) is conjugate base of (5S,9S,10S,13E)-labda-7,13-dien-15-yl diphosphate (CHEBI:63750) |
| IUPAC Name |
|---|
| (2E)-3-methyl-5-[(1S,4aS,8aS)-2,5,5,8a-tetramethyl-1,4,4a,5,6,7,8,8a-octahydronaphthalen-1-yl]pent-2-en-1-yl trihydrogen diphosphate |
| Synonym | Source |
|---|---|
| (13E)-labda-7,13-dien-15-yl diphosphate | ChEBI |
| Citations |
|---|