EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H14F3N3O2S |
| Net Charge | 0 |
| Average Mass | 369.368 |
| Monoisotopic Mass | 369.07588 |
| SMILES | Cc1c(OCC(F)(F)F)ccnc1CS(=O)c1nc2ccccc2n1 |
| InChI | InChI=1S/C16H14F3N3O2S/c1-10-13(20-7-6-14(10)24-9-16(17,18)19)8-25(23)15-21-11-4-2-3-5-12(11)22-15/h2-7H,8-9H2,1H3,(H,21,22) |
| InChIKey | MJIHNNLFOKEZEW-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Role: | EC 3.6.3.10 (H(+)/K(+)-exchanging ATPase) inhibitor An EC 3.6.3.* (acid anhydride hydrolase catalysing transmembrane movement of substances) inhibitor that inhibits H+/K+-exchanging ATPase, EC 3.6.3.10. Such compounds are also known as proton pump inhibitors. |
| Application: | anti-ulcer drug One of various classes of drugs with different action mechanisms used to treat or ameliorate peptic ulcer or irritation of the gastrointestinal tract. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| lansoprazole (CHEBI:6375) has role anti-ulcer drug (CHEBI:49201) |
| lansoprazole (CHEBI:6375) has role EC 3.6.3.10 (H+/K+-exchanging ATPase) inhibitor (CHEBI:49200) |
| lansoprazole (CHEBI:6375) is a benzimidazoles (CHEBI:22715) |
| lansoprazole (CHEBI:6375) is a pyridines (CHEBI:26421) |
| lansoprazole (CHEBI:6375) is a sulfoxide (CHEBI:22063) |
| IUPAC Name |
|---|
| 2-({[3-methyl-4-(2,2,2-trifluoroethoxy)pyridin-2-yl]methyl}sulfinyl)-1H-benzimidazole |
| INNs | Source |
|---|---|
| lansoprazol | ChemIDplus |
| lansoprazolum | ChemIDplus |
| Synonym | Source |
|---|---|
| AG 1749 | DrugBank |
| Brand Names | Source |
|---|---|
| Prevacid | DrugBank |
| Bamalite | DrugBank |
| Lanzol | DrugBank |
| Lanzopral | DrugBank |
| Lanzul | ChEBI |
| Limpidex | DrugBank |
| Registry Numbers | Sources |
|---|---|
| Beilstein:4333393 | Beilstein |
| CAS:103577-45-3 | ChemIDplus |