EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H18O10 |
| Net Charge | 0 |
| Average Mass | 406.343 |
| Monoisotopic Mass | 406.09000 |
| SMILES | O=c1c2cc(O)ccc2oc2c([C@@H]3O[C@H](CO)[C@@H](O)[C@H](O)[C@H]3O)c(O)cc(O)c12 |
| InChI | InChI=1S/C19H18O10/c20-5-11-15(25)16(26)17(27)19(29-11)13-9(23)4-8(22)12-14(24)7-3-6(21)1-2-10(7)28-18(12)13/h1-4,11,15-17,19-23,25-27H,5H2/t11-,15-,16+,17-,19+/m1/s1 |
| InChIKey | JUZGXATTXYZBGK-HBVDJMOISA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Gentiana utriculosa (ncbitaxon:49958) | aerial part (BTO:0001658) | PubMed (19296391) | |
| Metagentiana rhodantha (ncbitaxon:50767) | whole plant (BTO:0001461) | PubMed (22006717) | |
| Polygala sibirica (ncbitaxon:690825) | root (BTO:0001188) | PubMed (24702811) | |
| Polygala tenuifolia (ncbitaxon:355332) | cortex (PO:0005708) | PubMed (15974611) |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| lancerin (CHEBI:6373) has role plant metabolite (CHEBI:76924) |
| lancerin (CHEBI:6373) is a C-glycosyl compound (CHEBI:20857) |
| lancerin (CHEBI:6373) is a polyphenol (CHEBI:26195) |
| lancerin (CHEBI:6373) is a xanthones (CHEBI:51149) |
| IUPAC Name |
|---|
| (1S)-1,5-anhydro-1-(1,3,7-trihydroxy-9-oxo-9H-xanthen-4-yl)-D-glucitol |
| Synonym | Source |
|---|---|
| 4-C-Glucosyl-1,3,7-trihydroxyxanthone | KEGG COMPOUND |
| Citations |
|---|