EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H15N5O11P2 |
| Net Charge | 0 |
| Average Mass | 443.202 |
| Monoisotopic Mass | 443.02433 |
| SMILES | Nc1nc(=O)c2nc(=O)n([C@H]3C[C@H](O)[C@@H](COP(=O)(O)OP(=O)(O)O)O3)c2n1 |
| InChI | InChI=1S/C10H15N5O11P2/c11-9-13-7-6(8(17)14-9)12-10(18)15(7)5-1-3(16)4(25-5)2-24-28(22,23)26-27(19,20)21/h3-5,16H,1-2H2,(H,12,18)(H,22,23)(H2,19,20,21)(H3,11,13,14,17)/t3-,4+,5+/m0/s1 |
| InChIKey | LJMLTZSNWOCYNQ-VPENINKCSA-N |
| Roles Classification |
|---|
| Biological Role: | mouse metabolite Any mammalian metabolite produced during a metabolic reaction in a mouse (Mus musculus). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 8-oxo-dGDP (CHEBI:63728) is a purine 2'-deoxyribonucleoside 5'-diphosphate (CHEBI:37036) |
| 8-oxo-dGDP (CHEBI:63728) is conjugate acid of 8-oxo-dGDP(3−) (CHEBI:63715) |
| Incoming Relation(s) |
| 8-oxo-dGDP(3−) (CHEBI:63715) is conjugate base of 8-oxo-dGDP (CHEBI:63728) |
| IUPAC Name |
|---|
| 2'-deoxy-8-oxo-7,8-dihydroguanosine 5'-(trihydrogen diphosphate) |
| Synonyms | Source |
|---|---|
| 2'-deoxy-8-oxo-guanosine-5'-diphosphate | ChEBI |
| 8-oxo-2'-deoxyguanosine-5'-diphosphate | ChEBI |
| 8-oxodeoxyguanosine diphosphate | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:8595504 | Reaxys |