EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H30N5O10P.C4H4O4 |
| Net Charge | 0 |
| Average Mass | 635.520 |
| Monoisotopic Mass | 635.18399 |
| SMILES | CC(C)OC(=O)OCOP(=O)(CO[C@H](C)Cn1cnc2c(N)ncnc21)OCOC(=O)OC(C)C.O=C(O)/C=C/C(=O)O |
| InChI | InChI=1S/C19H30N5O10P.C4H4O4/c1-12(2)33-18(25)28-9-31-35(27,32-10-29-19(26)34-13(3)4)11-30-14(5)6-24-8-23-15-16(20)21-7-22-17(15)24;5-3(6)1-2-4(7)8/h7-8,12-14H,6,9-11H2,1-5H3,(H2,20,21,22);1-2H,(H,5,6)(H,7,8)/b;2-1+/t14-;/m1./s1 |
| InChIKey | VCMJCVGFSROFHV-WZGZYPNHSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Roles: | antiviral drug A substance used in the prophylaxis or therapy of virus diseases. HIV-1 reverse transcriptase inhibitor An entity which inhibits the activity of HIV-1 reverse transcriptase. |
| Applications: | antiviral drug A substance used in the prophylaxis or therapy of virus diseases. prodrug A compound that, on administration, must undergo chemical conversion by metabolic processes before becoming the pharmacologically active drug for which it is a prodrug. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| tenofovir disoproxil fumarate (CHEBI:63718) has part tenofovir disoproxil (CHEBI:63717) |
| tenofovir disoproxil fumarate (CHEBI:63718) has role antiviral drug (CHEBI:36044) |
| tenofovir disoproxil fumarate (CHEBI:63718) has role HIV-1 reverse transcriptase inhibitor (CHEBI:53756) |
| tenofovir disoproxil fumarate (CHEBI:63718) has role prodrug (CHEBI:50266) |
| tenofovir disoproxil fumarate (CHEBI:63718) is a fumarate salt (CHEBI:50921) |
| IUPAC Name |
|---|
| bis({[(propan-2-yloxy)carbonyl]oxy}methyl) ({[(2R)-1-(6-amino-9H-purin-9-yl)propan-2-yl]oxy}methyl)phosphonate (2E)-but-2-enedioate |
| Synonyms | Source |
|---|---|
| 9-((R)-2-((bis(((isopropoxycarbonyl)oxy)methoxy)phosphinyl)methoxy)propyl)adenine fumarate | ChemIDplus |
| TDF | ChEBI |
| tenofovir DF | ChEBI |
| Brand Name | Source |
|---|---|
| Viread | KEGG DRUG |
| Registry Numbers | Sources |
|---|---|
| Reaxys:9831556 | Reaxys |
| CAS:202138-50-9 | ChemIDplus |
| Citations |
|---|