EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C11H15N5O11P2 |
| Net Charge | -2 |
| Average Mass | 455.213 |
| Monoisotopic Mass | 455.02543 |
| SMILES | C[n+]1cn([C@@H]2O[C@H](COP(=O)([O-])OP(=O)([O-])[O-])[C@@H](O)[C@H]2O)c2nc(N)nc(=O)c21 |
| InChI | InChI=1S/C11H17N5O11P2/c1-15-3-16(8-5(15)9(19)14-11(12)13-8)10-7(18)6(17)4(26-10)2-25-29(23,24)27-28(20,21)22/h3-4,6-7,10,17-18H,2H2,1H3,(H5-,12,13,14,19,20,21,22,23,24)/p-2/t4-,6-,7-,10-/m1/s1 |
| InChIKey | SBASPRRECYVBRF-KQYNXXCUSA-L |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 7-methylguanosine 5'-diphosphate(2−) (CHEBI:63714) is a organophosphate oxoanion (CHEBI:58945) |
| 7-methylguanosine 5'-diphosphate(2−) (CHEBI:63714) is conjugate base of 7-methylguanosine 5'-diphosphate (CHEBI:63729) |
| Incoming Relation(s) |
| 7-methylguanosine 5'-diphosphate (CHEBI:63729) is conjugate acid of 7-methylguanosine 5'-diphosphate(2−) (CHEBI:63714) |
| IUPAC Name |
|---|
| 7-methyl-5'-O-[(phosphonatooxy)phosphinato]guanosine |
| Synonyms | Source |
|---|---|
| 7-methylguanosine 5'-diphosphate dianion | ChEBI |
| 7-methyl-GDP(2−) | ChEBI |
| UniProt Name | Source |
|---|---|
| N7-methyl-GDP | UniProt |
| Registry Numbers | Sources |
|---|---|
| Reaxys:9740597 | Reaxys |
| Citations |
|---|