EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H24 |
| Net Charge | 0 |
| Average Mass | 204.357 |
| Monoisotopic Mass | 204.18780 |
| SMILES | CC(C)=CCC[C@@H](C)[C@@]12CC=C(C)[C@@H]1C2 |
| InChI | InChI=1S/C15H24/c1-11(2)6-5-7-13(4)15-9-8-12(3)14(15)10-15/h6,8,13-14H,5,7,9-10H2,1-4H3/t13-,14+,15+/m1/s1 |
| InChIKey | UCQHFDKBUHCAFR-ILXRZTDVSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Fraxinus americana (ncbitaxon:38872) | - | PubMed (21574561) | Dichloromethane extract of volatile compound collected from freshly cut white ash |
| Ocimum basilicum (ncbitaxon:39350) | - | PubMed (21574561) | compound isolated in ZIS(alpha-zingeberene synthase) gene overexpressed in transgenic tomato |
| Phoebe porosa (IPNI:193807-2) | - | PubMed (21574561) | compound isolated from phoebe oil, an essential oil of Phoebe porosa |
| Zea mays (ncbitaxon:4577) | |||
| husk (BTO:0000609) | PubMed (21574561) | Volatile compound collected from husks of B73 inbred line | |
| leaf (BTO:0000713) | PubMed (21574561) | Volatile compound collected from husks of B73 inbred line |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 7-epi-sesquithujene (CHEBI:63710) has role metabolite (CHEBI:25212) |
| 7-epi-sesquithujene (CHEBI:63710) is a sesquiterpene (CHEBI:35189) |
| IUPAC Name |
|---|
| (1S,5R)-2-methyl-5-[(2R)-6-methylhept-5-en-2-yl]bicyclo[3.1.0]hex-2-ene |
| Synonym | Source |
|---|---|
| (+)-7-epi-sesquithujene | ChEBI |
| UniProt Name | Source |
|---|---|
| 7-epi-sesquithujene | UniProt |
| Registry Numbers | Sources |
|---|---|
| Reaxys:19474582 | Reaxys |
| Citations |
|---|