EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H24 |
| Net Charge | 0 |
| Average Mass | 204.357 |
| Monoisotopic Mass | 204.18780 |
| SMILES | C/C1=C\[C@H]2[C@@H](CC/C(C)=C/CC1)C2(C)C |
| InChI | InChI=1S/C15H24/c1-11-6-5-7-12(2)10-14-13(9-8-11)15(14,3)4/h6,10,13-14H,5,7-9H2,1-4H3/b11-6+,12-10+/t13-,14+/m1/s1 |
| InChIKey | VPDZRSSKICPUEY-JEPMYXAXSA-N |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| bicyclogermacrene (CHEBI:63709) has parent hydride germacrane (CHEBI:36514) |
| bicyclogermacrene (CHEBI:63709) has role metabolite (CHEBI:25212) |
| bicyclogermacrene (CHEBI:63709) is a sesquiterpene (CHEBI:35189) |
| IUPAC Name |
|---|
| (1S,2E,6E,10R)-3,7,11,11-tetramethylbicyclo[8.1.0]undeca-2,6-diene |
| UniProt Name | Source |
|---|---|
| bicyclogermacrene | UniProt |
| Manual Xrefs | Databases |
|---|---|
| LMPR0103100001 | LIPID MAPS |
| Registry Numbers | Sources |
|---|---|
| Reaxys:4231307 | Reaxys |
| Citations |
|---|