EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H24 |
| Net Charge | 0 |
| Average Mass | 204.357 |
| Monoisotopic Mass | 204.18780 |
| SMILES | CC1=CC=C([C@@]2(C)CCCC2(C)C)CC1 |
| InChI | InChI=1S/C15H24/c1-12-6-8-13(9-7-12)15(4)11-5-10-14(15,2)3/h6,8H,5,7,9-11H2,1-4H3/t15-/m1/s1 |
| InChIKey | DYQFFTPJVWEYMH-OAHLLOKOSA-N |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (−)-α-cuprenene (CHEBI:63701) has role plant metabolite (CHEBI:76924) |
| (−)-α-cuprenene (CHEBI:63701) is a alicyclic compound (CHEBI:33654) |
| (−)-α-cuprenene (CHEBI:63701) is a sesquiterpene (CHEBI:35189) |
| IUPAC Name |
|---|
| 1-methyl-4-[(1S)-1,2,2-trimethylcyclopentyl]cyclohexa-1,3-diene |
| UniProt Name | Source |
|---|---|
| (−)-α-cuprenene | UniProt |
| Manual Xrefs | Databases |
|---|---|
| C00036712 | KNApSAcK |
| Registry Numbers | Sources |
|---|---|
| Reaxys:8143778 | Reaxys |
| Citations |
|---|